CAS 50-69-1: Ribose
Description:Ribose is a naturally occurring sugar classified as a pentose monosaccharide, specifically an aldopentose, due to its five carbon atoms and an aldehyde functional group. Its molecular formula is C5H10O5, and it plays a crucial role in cellular metabolism, particularly in the synthesis of nucleotides and nucleic acids, such as RNA. Ribose is a key component of adenosine triphosphate (ATP), which is essential for energy transfer within cells. In its cyclic form, ribose can exist as a furanose ring, which is more stable in solution. Ribose is also known for its role in the pentose phosphate pathway, contributing to the production of ribonucleotides and NADPH, a vital reducing agent in biosynthetic reactions. Additionally, ribose is often used as a dietary supplement, particularly in sports nutrition, due to its potential to enhance energy recovery and improve exercise performance. Its CAS number is 50-69-1, and it is generally recognized as safe for consumption, although individuals with certain metabolic disorders should consult healthcare professionals before use.
Formula:C5H10O5
InChI:InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5-/m0/s1
InChI key:InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
SMILES:O=CC(O)C(O)C(O)CO
- Synonyms:
- <span class="text-smallcaps">D</span>-Ribose
- D(-)Ribose (1.07605)
- D(minus)ribose cell culture tested
- D-ribosa
- Ribose
- Ribose, <span class="text-smallcaps">D</span>-
- Ribose, D-
- Ribose, Pure
- beta-D-ribofuranose
- D-Ribose
- See more synonyms
- MeSH ID: D012266
- D-(-)-Ribose
- D-Ribose
