CymitQuimica logo

CAS 63782-90-1

:

Flamprop M-isopropyl

Description:
Flamprop M-isopropyl, with the CAS number 63782-90-1, is a chemical compound primarily used as a herbicide in agricultural applications. It belongs to the class of compounds known as phenoxy herbicides, which are characterized by their ability to mimic plant hormones and disrupt normal growth processes in target weeds. Flamprop M-isopropyl is particularly effective against a variety of broadleaf weeds and is often employed in cereal crops. The compound is typically formulated as a selective herbicide, meaning it targets specific weed species while minimizing harm to the crops. Its mode of action involves the inhibition of certain enzymatic pathways essential for plant growth. Flamprop M-isopropyl is generally applied in pre-emergence or post-emergence stages, depending on the specific crop and weed species. As with many agrochemicals, safety precautions are necessary during handling and application to minimize environmental impact and ensure human safety. Proper usage guidelines and regulations should be followed to maximize efficacy and reduce potential risks associated with herbicide application.
Formula:C19H19ClFNO3
InChI:InChI=1S/C19H19ClFNO3/c1-12(2)25-19(24)13(3)22(15-9-10-17(21)16(20)11-15)18(23)14-7-5-4-6-8-14/h4-13H,1-3H3/t13-/m1/s1
InChI key:InChIKey=IKVXBIIHQGXQRQ-CYBMUJFWSA-N
SMILES:N(C(=O)C1=CC=CC=C1)([C@@H](C(OC(C)C)=O)C)C2=CC(Cl)=C(F)C=C2
Synonyms:
  • Barnon Plus
  • D-Flamprop-isopropyl
  • D-Alanine, N-benzoyl-N-(3-chloro-4-fluorophenyl)-, 1-methylethyl ester
  • (-)-Flamprop-isopropyl
  • WL 43425
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.