CAS 66063-05-6: Pencycuron
Description:Pencycuron is a chemical compound classified as a fungicide, primarily used in agricultural applications to control various fungal diseases in crops. It belongs to the class of compounds known as phenylureas and is characterized by its systemic action, allowing it to be absorbed by plants and provide protection from pathogens. Pencycuron exhibits a broad spectrum of activity against several fungal species, making it effective in managing diseases such as powdery mildew and root rot. The compound is typically applied as a foliar spray or soil treatment, depending on the target crop and disease. Its mode of action involves inhibiting fungal growth by disrupting cellular processes. Pencycuron is generally considered to have low toxicity to mammals and birds, but like many agrochemicals, it should be handled with care to minimize environmental impact. Regulatory assessments often evaluate its safety profile, including potential effects on non-target organisms and the environment. Overall, Pencycuron serves as an important tool in integrated pest management strategies in agriculture.
Formula:C19H21ClN2O
InChI:InChI=1S/C19H21ClN2O/c20-16-12-10-15(11-13-16)14-22(18-8-4-5-9-18)19(23)21-17-6-2-1-3-7-17/h1-3,6-7,10-13,18H,4-5,8-9,14H2,(H,21,23)
InChI key:InChIKey=OGYFATSSENRIKG-UHFFFAOYSA-N
SMILES:O=C(NC=1C=CC=CC1)N(CC2=CC=C(Cl)C=C2)C3CCCC3
- Synonyms:
- 1-(4-Chlorobenzyl)-1-Cyclopentyl-3-Phenylurea
- 1-(P-Chlorobenzyl)-1-Cyclopentyl-3-Phenylurea
- Bay Ntn 19701
- Monceraen 250SC
- Monceren
- Monceren (Tm)
- N-[(4-Chlorophenyl)Methyl]-N-Cyclopentyl-N'-Phenylurea
- Ntn 19701
- Urea, N-[(4-chlorophenyl)methyl]-N-cyclopentyl-N′-phenyl-
- [(Chlorophenyl)-methyl]-N-cyclopentyl-N'-phenylurea
- See more synonyms
- Pencycuron
