CAS 93952-07-9
:triacontane-D62
Description:
Triacontane-D62, with the CAS number 93952-07-9, is a deuterated form of triacontane, a straight-chain alkane consisting of 30 carbon atoms. As a hydrocarbon, it is characterized by its hydrophobic nature and low reactivity, typical of alkanes. The presence of deuterium, a stable isotope of hydrogen, in its molecular structure enhances its utility in various scientific applications, particularly in nuclear magnetic resonance (NMR) spectroscopy and studies involving isotopic labeling. Triacontane-D62 is typically a colorless, odorless solid at room temperature, exhibiting a high melting point and low volatility. Its molecular structure contributes to its stability and resistance to oxidation, making it suitable for use in organic synthesis and as a reference material in analytical chemistry. Additionally, due to its long carbon chain, it may exhibit properties such as wax-like consistency and hydrophobicity, which can influence its behavior in different chemical environments. Overall, triacontane-D62 serves as a valuable compound in both research and industrial applications.
Formula:C30D62
InChI:InChI=1/C30H62/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-30H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2,16D2,17D2,18D2,19D2,20D2,21D2,22D2,23D2,24D2,25D2,26D2,27D2,28D2,29D2,30D2
SMILES:C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]
Synonyms:- (2H62)triacontane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
n-Triacontane-d62
CAS:Formula:CD3(CD2)28CD3Purity:98 atom % DColor and Shape:White SolidMolecular weight:484.87431GB 31660.1-2019 Macrolide Antibiotics Mixture 167 100 µg/mL in Methanol
CAS:Controlled ProductColor and Shape:Mixturen-Triacontane-d62
CAS:Controlled ProductApplications n-Triacontane-d62 is the labeled compound of Triacontane (CAS #: 638-68-6). Triacontane releases selective material in thermally degradable capsule. It also, increases charge carrier mobility and molecular packing of a solution sheared Diketopyrrolopyrrole-based donor-acceptor copolymer by Alkyl side chain modification.
References Shkolnikov, V., et al.; PCT Int. Appl., (2018); Hambsch, M., et al.: Journal of Materials Chemistry C: Materials for Optical and Electronic Devices, 7, 3665-3674, (2019);Formula:C30D62Color and Shape:NeatMolecular weight:485.2n-Triacontane-d62
CAS:Formula:C30D62Purity:97%,98atom%DColor and Shape:SolidMolecular weight:485.1953




