CAS 1420-07-1: Dinoterb
Description:Dinoterb, with the CAS number 1420-07-1, is a chemical compound primarily recognized as a herbicide. It belongs to the class of compounds known as phenoxy herbicides, which are commonly used in agricultural practices to control broadleaf weeds. Dinoterb is characterized by its selective action, targeting specific plant species while minimizing harm to crops. The compound is typically applied in various formulations, including emulsifiable concentrates and granules, and is effective in a range of environmental conditions. Its mode of action involves disrupting the growth processes of target plants, leading to their eventual death. Dinoterb is known for its relatively low toxicity to mammals, making it a preferred choice in certain agricultural applications. However, like many herbicides, it requires careful handling and application to mitigate potential environmental impacts, particularly concerning non-target species and water sources. Regulatory assessments often evaluate its environmental fate, persistence, and potential for bioaccumulation to ensure safe usage in agricultural settings.
Formula:C10H12N2O5
InChI:InChI=1S/C10H12N2O5/c1-10(2,3)7-4-6(11(14)15)5-8(9(7)13)12(16)17/h4-5,13H,1-3H3
InChI key:InChIKey=IIPZYDQGBIWLBU-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C=C(C(O)=C(C1)C(C)(C)C)N(=O)=O
- Synonyms:
- 2,4-Dinitro-6-tert-butylphenol
- 2-(1,1-Dimethylethyl)-4,6-dinitrophenol
- 2-Tert-Butyl-4,6-Dinitrophenol
- 4,6-Dinitro-2-tert-butylphenol
- Dinoterbe
- Dntbp
- Herbogil
- NSC 166496
- Phenol, 2-(1,1-dimethylethyl)-4,6-dinitro-
- Phenol, 2-tert-butyl-4,6-dinitro-
- See more synonyms
- Stirpan Forte
- Veraline Creme
- Dinoterb
