CAS 160807-49-8
:INDIRUBIN-3'-MONOXIME
Description:
Indirubin-3'-monoxime is a synthetic compound derived from indirubin, a natural product known for its biological activity. It is characterized by its unique molecular structure, which includes an oxime functional group that contributes to its reactivity and potential pharmacological properties. This compound is often studied for its role in various biological processes, particularly in the context of cancer research, as it has been shown to exhibit anti-proliferative effects on certain cancer cell lines. Indirubin-3'-monoxime is also noted for its ability to inhibit specific kinases, which are enzymes that play critical roles in cell signaling pathways. Its solubility and stability in different solvents can vary, influencing its application in laboratory settings. Additionally, the compound's safety profile and toxicity are important considerations in its use for research purposes. Overall, indirubin-3'-monoxime represents a significant area of interest in medicinal chemistry, particularly for its potential therapeutic applications.
Formula:C16H11N3O2
InChI:InChI=1/C16H11N3O2/c20-16-13(9-5-1-3-7-11(9)18-16)15-14(19-21)10-6-2-4-8-12(10)17-15/h1-8,17,21H,(H,18,20)/b15-13-,19-14+
Synonyms:- ;3-[1,3-Dihydro-3-(Hydroxyimino)-2H-Indol-2-Ylidene]-1,3-Dihydro-2H-Indol-2-One
- Indirubin-3'-Oxime
- Indirubine-3'-oxime;
- 3-(hydroxyamino)-1H,2'H-2,3'-biindol-2'-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2H-Indol-2-one, 3-[1,3-dihydro-3-(hydroxyimino)-2H-indol-2-ylidene]-1,3-dihydro-
CAS:Formula:C16H11N3O2Purity:98%Color and Shape:SolidMolecular weight:277.27743-(Hydroxyimino)-[2,3’-Biindolinylidene]-2’-One
CAS:3-(Hydroxyimino)-[2,3’-Biindolinylidene]-2’-OnePurity:98%Molecular weight:277.28g/molIndirubin-3'-monoxime
CAS:Formula:C16H11N3O2Purity:>98.0%(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:277.28Indirubin-3'-monoxime
CAS:Indirubin-3'-monoxime (Indirubin-3'-oxime) is a potent inhibitor of GSK3β (IC50: 22 nM) and also inhibits CDKs ( (IC50s: 100/180/250 nM for Cdk5/p35, Cdk1/Formula:C16H11N3O2Purity:99.55%Color and Shape:Dark Red SolidMolecular weight:277.28Indirubin-3'-monoxime
CAS:<p>Inhibitor of YB-1 nuclear translocation; anti-cancer</p>Formula:C16H11N3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:277.28 g/mol





