CAS 16118-49-3: carbetamide
Description:Carbetamide, with the CAS number 16118-49-3, is a chemical compound primarily recognized for its use as a herbicide. It belongs to the class of amides and is characterized by its ability to inhibit the growth of certain weeds, making it valuable in agricultural applications. The molecular structure of carbetamide features a carbonyl group (C=O) bonded to a nitrogen atom, which is typical of amides, contributing to its reactivity and biological activity. Carbetamide is generally soluble in organic solvents, which facilitates its application in various formulations. Its mode of action involves disrupting the metabolic processes of target plants, leading to their eventual death. While it is effective in controlling specific weed species, its use is regulated due to potential environmental impacts and toxicity to non-target organisms. Safety measures are recommended when handling carbetamide to mitigate risks associated with exposure. Overall, carbetamide exemplifies the intersection of chemistry and agriculture, showcasing the importance of chemical substances in modern farming practices.
Formula:C12H16N2O3
InChI:InChI=1S/C12H16N2O3/c1-3-13-11(15)9(2)17-12(16)14-10-7-5-4-6-8-10/h4-9H,3H2,1-2H3,(H,13,15)(H,14,16)/t9-/m1/s1
InChI key:InChIKey=AMRQXHFXNZFDCH-SECBINFHSA-N
SMILES:O=C(OC(C(=O)NCC)C)NC=1C=CC=CC1
- Synonyms:
- Carbetamide
- Propanamide, N-ethyl-2-[[(phenylamino)carbonyl]oxy]-, (2R)-
- Propanamide, N-ethyl-2-[[(phenylamino)carbonyl]oxy]-, (R)-
- (2R)-N-Ethyl-2-[[(phenylamino)carbonyl]oxy]propanamide
- Lactamide, N-ethyl-, carbanilate (ester), D-
