CymitQuimica logo

CAS 28044-83-9

:

(1aS,6aS)-2,3,4,5,6,7,7-heptachloro-1b,2,5,5a,6,6a-hexahydro-1aH-2,5-methanoindeno[1,2-b]oxirene

Description:
The chemical substance known as (1aS,6aS)-2,3,4,5,6,7,7-heptachloro-1b,2,5,5a,6,6a-hexahydro-1aH-2,5-methanoindeno[1,2-b]oxirene, with CAS number 28044-83-9, is a synthetic organic compound characterized by its complex polycyclic structure and multiple chlorine substituents. This compound belongs to a class of chemicals known for their potential use in various applications, including as insecticides or herbicides, due to their biological activity. The presence of seven chlorine atoms contributes to its stability and lipophilicity, which can influence its environmental persistence and bioaccumulation potential. The stereochemistry indicated by the (1aS,6aS) configuration suggests specific spatial arrangements that may affect its reactivity and interaction with biological systems. Additionally, the oxirane (epoxide) functional group in its structure may impart unique chemical reactivity, making it a subject of interest in both synthetic chemistry and toxicology studies. Overall, this compound exemplifies the complexity and diversity of chlorinated organic compounds in chemical research.
Formula:C10H5Cl7O
InChI:InChI=1/C10H5Cl7O/c11-3-1-2(4-5(3)18-4)9(15)7(13)6(12)8(1,14)10(9,16)17/h1-5H/t1?,2?,3?,4-,5?,8?,9?/m0/s1
InChI key:ZXFXBSWRVIQKOD-WOBUKFROSA-N
SMILES:C12C([C@H]3C(C1Cl)O3)C1(C(=C(C2(C1(Cl)Cl)Cl)Cl)Cl)Cl
products per page.Found 42 products.