CAS 29477-83-6: Narciclasine
Description:Narciclasine is a naturally occurring alkaloid primarily derived from the plant Narcissus, commonly known as daffodil. It is classified as a member of the Amaryllidaceae family and is known for its complex structure, which includes a fused ring system. This compound exhibits a range of biological activities, including potential anti-cancer properties, as it has been shown to inhibit cell proliferation in various cancer cell lines. Narciclasine interacts with cellular mechanisms, particularly affecting microtubule dynamics, which is crucial for cell division. Additionally, it has been studied for its neuroprotective effects and potential applications in treating neurodegenerative diseases. The compound is characterized by its solubility in organic solvents and relatively low solubility in water, which can influence its bioavailability and pharmacokinetics. As research continues, narciclasine's therapeutic potential and mechanisms of action are being explored, highlighting its significance in medicinal chemistry and pharmacology.
Formula:C14H13NO7
InChI:InChI=1S/C14H13NO7/c16-6-1-5-4-2-7-13(22-3-21-7)11(18)8(4)14(20)15-9(5)12(19)10(6)17/h1-2,6,9-10,12,16-19H,3H2,(H,15,20)/t6-,9+,10+,12-/m0/s1
InChI key:InChIKey=LZAZURSABQIKGB-AEKGRLRDSA-N
SMILES:O=C1NC2C(=CC(O)C(O)C2O)C=3C=C4OCOC4=C(O)C13
- Synonyms:
- (+)-Lycoricidinol
- (+)-Narciclasine
- (2S,3R,4S,4aR)-3,4,4a,5-Tetrahydro-2,3,4,7-tetrahydroxy[1,3]dioxolo[4,5-j]phenanthridin-6(2H)-one
- NSC 266535
- [1,3]Dioxolo[4,5-j]phenanthridin-6(2H)-one, 3,4,4a,5-tetrahydro-2,3,4,7-tetrahydroxy-, [2S-(2α,3β,4β,4aβ)]-
- [1,3]dioxolo[4,5-j]phenanthridin-6(2H)-one, 3,4,4a,5-tetrahydro-2,3,4,7-tetrahydroxy-, (2S,3R,4S,4aR)-
- (2S,3R,4S,4aR)-2,3,4,7-Tetrahydroxy-3,4,4a,5-tetrahydro[1,3]dioxolo[4,5-j]phenanthridin-6(2H)-one
![[1,3]Dioxolo[4,5-j]phenanthridin-6(2H)-one, 3,4,4a,5-tetrahydro-2,3,4,7-tetrahydroxy-, (2S,3R,4S,4…](https://static.cymitquimica.com/products/IN/thumb/DA002YIC.jpg)
