CAS 5103-73-1: cis-Nonachlor
Description:Cis-Nonachlor, with the CAS number 5103-73-1, is a chlorinated hydrocarbon that belongs to the class of organochlorines. It is a geometric isomer of nonachlor, characterized by its specific arrangement of chlorine atoms around the carbon chain. This compound is typically a colorless to pale yellow solid at room temperature and is known for its persistence in the environment due to its stable chemical structure. Cis-Nonachlor is primarily used as a pesticide, particularly in agricultural applications, although its use has been restricted or banned in many countries due to environmental and health concerns. It is lipophilic, meaning it tends to accumulate in fatty tissues of living organisms, leading to bioaccumulation and potential toxicity in the food chain. The compound is also subject to regulatory scrutiny due to its potential effects on human health, including endocrine disruption and carcinogenicity. Proper handling and disposal are essential to mitigate its environmental impact.
Formula:C10H5Cl9
InChI:InChI=1/C10H5Cl9/c11-3-1-2(4(12)5(3)13)9(17)7(15)6(14)8(1,16)10(9,18)19/h1-5H/t1-,2+,3+,4-,5+,8+,9-
InChI key:InChIKey=OCHOKXCPKDPNQU-KCCZGPNFNA-N
SMILES:ClC1=C(Cl)C2(Cl)C3C(Cl)C(Cl)C(Cl)C3C1(Cl)C2(Cl)Cl
- Synonyms:
- 4,7-Methanoindan, 1α,2α,3α,4β,5,6,7β,8,8-nonachloro-3aα,4,7,7aα-tetrahydro-
- Nonachlor, cis-
- 4,7-Methano-1H-indene, 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-, (1R,3S,3aR,4S,7R,7aS)-rel-
- rel-(1R,3S,3aR,4S,7R,7aS)-1,2,3,4,5,6,7,8,8-Nonachloro-2,3,3a,4,7,7a-hexahydro-4,7-methano-1H-indene
- 4,7-Methano-1H-indene, 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-, (1α,2α,3α,3aα,4β,7β,7aα)-
