CAS 61432-55-1: Dimepiperate
Description:Dimepiperate, with the CAS number 61432-55-1, is a chemical compound that belongs to the class of piperidine derivatives. It is characterized by its dual piperidine structure, which contributes to its pharmacological properties. Dimepiperate is primarily recognized for its role as a cholinergic agent, acting as a reversible inhibitor of acetylcholinesterase, thereby enhancing the levels of acetylcholine in the synaptic cleft. This mechanism makes it of interest in the study of cognitive enhancement and potential therapeutic applications in neurodegenerative diseases. The compound is typically presented as a white to off-white solid and is soluble in polar solvents. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Safety data indicates that, like many chemical substances, it should be handled with care, following appropriate safety protocols to mitigate any potential hazards. Overall, dimepiperate's unique structure and biological activity make it a subject of interest in medicinal chemistry and pharmacology.
Formula:C15H21NOS
InChI:InChI=1S/C15H21NOS/c1-15(2,13-9-5-3-6-10-13)18-14(17)16-11-7-4-8-12-16/h3,5-6,9-10H,4,7-8,11-12H2,1-2H3
InChI key:InChIKey=BWUPSGJXXPATLU-UHFFFAOYSA-N
SMILES:O=C(SC(C=1C=CC=CC1)(C)C)N2CCCCC2
- Synonyms:
- 1-Piperidinecarbothioic acid, S-(1-methyl-1-phenylethyl) ester
- Dimepiperate
- Muw 1193
- My 93
- S-(2-phenylpropan-2-yl) piperidine-1-carbothioate
- Yukamate
