CAS 81335-77-5: Imazethapyr
Description:Imazethapyr is a selective herbicide primarily used in agriculture for the control of various broadleaf and grassy weeds in crops such as soybeans and peanuts. It belongs to the imidazolinone class of herbicides and functions by inhibiting the enzyme acetolactate synthase (ALS), which is crucial for the synthesis of essential amino acids in plants. This inhibition leads to the cessation of growth and eventual death of the targeted weeds. Imazethapyr is characterized by its systemic action, allowing it to be absorbed by the roots and foliage of plants. It is typically applied pre-emergence or post-emergence, depending on the specific crop and weed species. The compound is moderately soluble in water and has a relatively low volatility, which contributes to its effectiveness in soil applications. Additionally, Imazethapyr is known for its residual activity, which can provide extended weed control. However, its use requires careful management to prevent potential impacts on non-target plants and to mitigate the development of herbicide-resistant weed populations.
Formula:C15H19N3O3
InChI:InChI=1S/C15H19N3O3/c1-5-9-6-10(13(19)20)11(16-7-9)12-17-14(21)15(4,18-12)8(2)3/h6-8H,5H2,1-4H3,(H,19,20)(H,17,18,21)
InChI key:InChIKey=XVOKUMIPKHGGTN-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(C=NC1C2=NC(=O)C(N2)(C)C(C)C)CC
- Synonyms:
- (.+-.)-Imazethapyr
- (±)-5-Ethyl-2-(4-isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)nicotinic acid
- 2-[4,5-Dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-ethyl-3-pyridinecarboxylic acid
- 5-Ethyl-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl) nicotinic acid
- Ac 263499
- Cl 263499
- Fabian
- Pivot
- Pursuit
- Pursuit 10
- See more synonyms
- 3-Pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-ethyl-
- (+-)-midazol-2-yl)-5-ethyl
- PURSUIT DG
- ac263,499
- 5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1h-imidazol-2-yl)-5-ethyl-2-((+-)-3-pyridinecarboxylicaci
- Pursuit,2-(4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl)-5-ethyl-3-pyridinecarboxylic acid
- PURSUIT(R)
- (RS)-5-ETHYL-2-(4-ISOPROPYL-4-METHYL-5-OXO-2-IMIDAZOLIN-2-YL)-NICOTINIC ACID
- 5-Ethyl-2-(4-isopropyl-4-methyl-5-oxo-1H-imidazolin-2-yl)nicotinic acid
- 5-dihydro-4-methyl-4(1-methylethyl)-5-oxo-1h-imidazol-2yl)-5-ethyl-3-(+-)-2-(
- (+/-)-2-[4,5-dihydro-4-methyl-4-(1-methyltheyl)-5-oxo-1Himidazol-2-yl]-5-ethyl-3-pyridinecarboxy acid
