CAS 10285-06-0: INTERMEDINE
Description:Intermedine, with the CAS number 10285-06-0, is a chemical compound that belongs to the class of alkaloids, which are naturally occurring organic compounds that mostly contain basic nitrogen atoms. Alkaloids are known for their diverse pharmacological effects and can be derived from various plant sources. Intermedine is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. While specific physical and chemical properties such as melting point, solubility, and reactivity may vary, alkaloids like Intermedine often exhibit significant biological activity, including potential effects on the central nervous system. The compound may also have implications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies and data on Intermedine's specific characteristics, including its mechanism of action and potential applications, are essential for a comprehensive understanding of its role in pharmacology and toxicology.
Formula:C15H25NO5
InChI:InChI=1S/C15H25NO5/c1-9(2)15(20,10(3)17)14(19)21-8-11-4-6-16-7-5-12(18)13(11)16/h4,9-10,12-13,17-18,20H,5-8H2,1-3H3/t10-,12-,13-,15+/m1/s1
InChI key:InChIKey=SFVVQRJOGUKCEG-OPQSFPLASA-N
SMILES:O=C(OCC1=CCN2CCC(O)C12)C(O)(C(O)C)C(C)C
- Synonyms:
- 3′-epi-Lycopsamine
- Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, (2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl)methyl ester, [1R-[1α,7(2S*,3R*),7aβ]]-
- Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, [(1R,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl]methyl ester, (2S,3R)-
- Intermidine
- [(1R,7aR)-1-hydroxy-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methyl (2S,3R)-2,3-dihydroxy-2-(propan-2-yl)butanoate