CAS 38710-26-8
:Seneciphylline N-oxide
Description:
Seneciphylline N-oxide is a chemical compound classified as an alkaloid, specifically a pyrrolizidine alkaloid, which is derived from plants in the Senecio genus. It is characterized by its complex bicyclic structure, which includes a nitrogen atom in a five-membered ring. This compound is known for its potential biological activity, including hepatotoxicity and carcinogenicity, which has raised concerns regarding its presence in herbal products and dietary supplements. Seneciphylline N-oxide is typically found in various plant species and can be produced through the oxidation of seneciphylline. Its molecular formula reflects the presence of carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its unique properties. The compound is often studied for its effects on human health, particularly in relation to liver function and toxicity. Due to its potential health risks, regulatory agencies monitor its levels in food and herbal products to ensure consumer safety.
Formula:C18H23NO6
InChI:InChI=1/C18H23NO6/c1-4-12-9-11(2)18(3,22)17(21)24-10-13-5-7-19(23)8-6-14(15(13)19)25-16(12)20/h4-5,14-15,22H,2,6-10H2,1,3H3/t14-,15-,18-,19?/m1/s1
InChI key:InChIKey=COHUFMBRBUPZPA-TUSLHEEYSA-N
SMILES:O=N12[C@]3([C@@](CC1)(OC(=O)/C(=C\C)/CC(=C)[C@@](C)(O)C(=O)OCC3=CC2)[H])[H]
Synonyms:- [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-methyl-5-methylene-, 12-oxide, (3Z,6R,14aR,14bR)-[partial]-
- [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-methyl-5-methylene-, 12-oxide, (3Z,6R,14aR,14bR)-
- Seneciphylline N-oxide
- Seneciphylline oxide
- Senecionan-11,16-dione, 13,19-didehydro-12-hydroxy-, 4-oxide
- Seneciphylline N-oxid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Seneciphylline N-oxide
CAS:Seneciphylline N-oxide is a pyrrolizidine alkaloid obtained from Emilia sonchifolia and is the dehydrogenation product of Senecionine N-oxide.Formula:C18H23NO6Purity:98%Color and Shape:SolidMolecular weight:349.38Seneciphylline-N-oxide 100 µg/mL in Water
CAS:Controlled ProductFormula:C18H23NO6Color and Shape:ColourlessMolecular weight:349.38Seneciphylline N-Oxide-d3
CAS:Formula:C18H20D3NO6Color and Shape:White To Off-White SolidMolecular weight:352.40Seneciphylline N-oxide
CAS:Natural alkaloidFormula:C18H23NO6Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:349.38Seneciphylline N-oxide
CAS:Seneciphylline N-oxide is a type of pyrrolizidine alkaloid derivative, which is commonly found in certain species of the Crotalaria plant. This compound is primarily extracted from these plants as a secondary metabolite. The functional mechanism of Seneciphylline N-oxide involves metabolic conversion by hepatic enzymes to form reactive intermediates that can potentially bind to cellular macromolecules.Formula:C18H23NO6Purity:Min. 95%Color and Shape:PowderMolecular weight:349.38 g/mol









