CAS 38710-26-8: Seneciphylline N-oxide
Description:Seneciphylline N-oxide is a chemical compound classified as an alkaloid, specifically a pyrrolizidine alkaloid, which is derived from plants in the Senecio genus. It is characterized by its complex bicyclic structure, which includes a nitrogen atom in a five-membered ring. This compound is known for its potential biological activity, including hepatotoxicity and carcinogenicity, which has raised concerns regarding its presence in herbal products and dietary supplements. Seneciphylline N-oxide is typically found in various plant species and can be produced through the oxidation of seneciphylline. Its molecular formula reflects the presence of carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its unique properties. The compound is often studied for its effects on human health, particularly in relation to liver function and toxicity. Due to its potential health risks, regulatory agencies monitor its levels in food and herbal products to ensure consumer safety.
Formula:C18H23NO6
InChI:InChI=1S/C18H23NO6/c1-4-12-9-11(2)18(3,22)17(21)24-10-13-5-7-19(23)8-6-14(15(13)19)25-16(12)20/h4-5,14-15,22H,2,6-10H2,1,3H3/b12-4-/t14-,15-,18-,19?/m1/s1
InChI key:InChIKey=COHUFMBRBUPZPA-TUSLHEEYSA-N
SMILES:O=C1OC2CCN3(=O)CC=C(COC(=O)C(O)(C(=C)CC1=CC)C)C23
- Synonyms:
- [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-methyl-5-methylene-, 12-oxide, (3Z,6R,14aR,14bR)-[partial]-
- [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-methyl-5-methylene-, 12-oxide, (3Z,6R,14aR,14bR)-
- Seneciphylline N-oxide
- Seneciphylline oxide
- Senecionan-11,16-dione, 13,19-didehydro-12-hydroxy-, 4-oxide
- See more synonyms
- Seneciphylline N-oxid
