CAS 570-19-4
:Europine
Description:
Europine, with the CAS number 570-19-4, is a chemical compound that belongs to the class of phenolic compounds. It is characterized by its structure, which includes a hydroxyl group attached to a phenolic ring, contributing to its reactivity and potential applications in various fields. Europine is known for its fluorescent properties, making it useful in analytical chemistry and as a fluorescent probe in biological studies. The compound is typically found in a solid state and may exhibit solubility in organic solvents. Its fluorescence can be influenced by environmental factors such as pH and solvent polarity. Europine's unique properties have led to its exploration in areas such as photochemistry and materials science. However, like many chemical substances, it should be handled with care, considering safety protocols due to potential toxicity or reactivity. Overall, europine is a notable compound in the realm of organic chemistry, with applications that leverage its distinctive characteristics.
Formula:C16H27NO6
InChI:InChI=1S/C16H27NO6/c1-10(22-4)16(21,15(2,3)20)14(19)23-9-11-5-7-17-8-6-12(18)13(11)17/h5,10,12-13,18,20-21H,6-9H2,1-4H3/t10-,12-,13+,16-/m0/s1
InChI key:InChIKey=ZNEMYFCJOCCUJN-VFFTVRQLSA-N
SMILES:C(OC([C@@]([C@@H](OC)C)(C(C)(C)O)O)=O)C=1[C@]2(N(CC1)CC[C@@H]2O)[H]
Synonyms:- Europin
- Europine
- L-threo-Pentitol, 1,5-dideoxy-2-C-methyl-4-O-methyl-3-C-[[[(1S,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl]methoxy]carbonyl]-
- 1,5-Dideoxy-2-C-methyl-4-O-methyl-3-C-[[[(1S,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl]methoxy]carbonyl]-L-threo-pentitol
- Butanoic acid, 2,3-dihydroxy-2-(1-methoxyethyl)-3-methyl-, (2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl)methyl ester, [1S-[1α,7[S*(R*)],7aα]]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Europine hydrochloride (Standard)
CAS:Europine hydrochloride (Standard) is a reference standard of Europine hydrochloride intended for quantitative analysis, quality control, and related biochemical research applications.Formula:C16H27NO6Color and Shape:SolidMolecular weight:329.39Europine 100 µg/mL in Water
CAS:Controlled ProductFormula:C16H27NO6Color and Shape:ColourlessMolecular weight:329.39Europine hydrochloride
CAS:Natural alkaloidFormula:C16H27NO6HClPurity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:365.86Europine HCl
CAS:Europine HCl is a synthetic alkaloid derivative, which is sourced from the modification of naturally occurring tropane alkaloids. This compound acts primarily as a competitive antagonist at muscarinic acetylcholine receptors, thereby influencing cholinergic neurotransmission. Its mode of action involves the inhibition of acetylcholine binding, leading to reduced parasympathetic nervous system activity.
Formula:C16H27NO6·HClPurity:Min. 95%Color and Shape:Colorless PowderMolecular weight:365.85 g/mol






