CAS 570-19-4: Europine
Description:Europine, with the CAS number 570-19-4, is a chemical compound that belongs to the class of phenolic compounds. It is characterized by its structure, which includes a hydroxyl group attached to a phenolic ring, contributing to its reactivity and potential applications in various fields. Europine is known for its fluorescent properties, making it useful in analytical chemistry and as a fluorescent probe in biological studies. The compound is typically found in a solid state and may exhibit solubility in organic solvents. Its fluorescence can be influenced by environmental factors such as pH and solvent polarity. Europine's unique properties have led to its exploration in areas such as photochemistry and materials science. However, like many chemical substances, it should be handled with care, considering safety protocols due to potential toxicity or reactivity. Overall, europine is a notable compound in the realm of organic chemistry, with applications that leverage its distinctive characteristics.
Formula:C16H27NO6
InChI:InChI=1S/C16H27NO6/c1-10(22-4)16(21,15(2,3)20)14(19)23-9-11-5-7-17-8-6-12(18)13(11)17/h5,10,12-13,18,20-21H,6-9H2,1-4H3/t10-,12-,13+,16-/m0/s1
InChI key:InChIKey=ZNEMYFCJOCCUJN-VFFTVRQLSA-N
SMILES:O=C(OCC1=CCN2CCC(O)C12)C(O)(C(OC)C)C(O)(C)C
- Synonyms:
- Europin
- Europine
- L-threo-Pentitol, 1,5-dideoxy-2-C-methyl-4-O-methyl-3-C-[[[(1S,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl]methoxy]carbonyl]-
- 1,5-Dideoxy-2-C-methyl-4-O-methyl-3-C-[[[(1S,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl]methoxy]carbonyl]-L-threo-pentitol
- Butanoic acid, 2,3-dihydroxy-2-(1-methoxyethyl)-3-methyl-, (2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl)methyl ester, [1S-[1α,7[S*(R*)],7aα]]-
