CAS 72755-25-0: Senecivernine
Description:Senecivernine is a pyrrolizidine alkaloid, a class of naturally occurring compounds primarily found in various plant species, particularly those in the Asteraceae family. This compound is characterized by its complex bicyclic structure, which includes a nitrogen atom in a five-membered ring. Senecivernine is known for its potential hepatotoxic effects, which can arise from metabolic activation leading to the formation of reactive intermediates. These intermediates can cause cellular damage, particularly in the liver, and are associated with various health risks when ingested in significant amounts. The compound has garnered interest in pharmacological and toxicological studies due to its biological activity and the implications for human health, especially in relation to herbal remedies and traditional medicine. Additionally, senecivernine's presence in certain plants raises concerns regarding its safety in dietary supplements and herbal products. As with many pyrrolizidine alkaloids, the regulation and monitoring of senecivernine in consumer products are essential to mitigate potential health risks.
Formula:C18H25NO5
InChI:InChI=1S/C18H25NO5/c1-10-11(2)16(20)24-14-6-8-19-7-5-13(15(14)19)9-23-17(21)18(4,22)12(10)3/h5,10,12,14-15,22H,2,6-9H2,1,3-4H3
InChI key:InChIKey=FLUOSFVUPTUYEX-UHFFFAOYSA-N
SMILES:O=C1OC2CCN3CC=C(COC(=O)C(O)(C)C(C)C(C1=C)C)C32
- Synonyms:
- (4R,5R,6R,14aR,14bR)-3,4,5,6,9,11,13,14,14a,14b-Decahydro-6-hydroxy-4,5,6-trimethyl-3-methylene[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione
- (4R,5R,6R,14aR,14bR)-6-Hydroxy-4,5,6-trimethyl-3-methylene-3,4,5,6,9,11,13,14,14a,14b-decahydro[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione
- 21-Norsenecionan-11,16-dione, 12-hydroxy-14-methyl-, (14α)-
- Senecivernine
- [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-4,5,6-trimethyl-3-methylene-, [4R-(4R*,5R*,6R*,14aR*,14bR*)]-
- [1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-4,5,6-trimethyl-3-methylene-, (4R,5R,6R,14aR,14bR)-
- SENECIVERNIN
- 12-hydroxy-14ξ-methyl-(12ξH,13ξH)-21-nor-senecionane-11,16-dione
- FLUOSFVUPTUYEX-QHOAOGIMSA-N
