CAS 130-01-8: senecionine
Description:Senecionine is a pyrrolizidine alkaloid, a class of compounds known for their complex bicyclic structures and potential toxicity. It is primarily derived from plants in the Asteraceae family, particularly those in the genus Senecio. Senecionine is characterized by its molecular formula, which typically includes nitrogen and various carbon and hydrogen atoms, contributing to its unique structural properties. This compound is known for its hepatotoxic effects, which can lead to liver damage upon ingestion, making it a subject of concern in herbal medicine and toxicology. Senecionine can also exhibit mutagenic properties, raising further health concerns. Its presence in certain plants can lead to accidental poisoning in livestock and humans, particularly when consumed in large quantities or over extended periods. As a result, understanding its chemical behavior, potential interactions, and effects on biological systems is crucial for assessing risks associated with exposure to this alkaloid.
Formula:C18H25NO5
InChI:InChI=1S/C18H25NO5/c1-4-12-9-11(2)18(3,22)17(21)23-10-13-5-7-19-8-6-14(15(13)19)24-16(12)20/h4-5,11,14-15,22H,6-10H2,1-3H3/b12-4-/t11-,14-,15-,18-/m1/s1
InChI key:InChIKey=HKODIGSRFALUTA-JTLQZVBZSA-N
SMILES:O=C1OC2CCN3CC=C(COC(=O)C(O)(C)C(C)CC1=CC)C32
- Synonyms:
- (15Z)-12-hydroxysenecionan-11,16-dione
- (3Z,5R,6R,14aR,14bR)-3-Ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-5,6-dimethyl[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione
- 12-Hydroxysenecionan-11,16-Dione
- Aureine
- NSC 89935
- Senecionan-11,16-dione, 12-hydroxy-
- Senecionin
- [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-5,6-dimethyl-, (3Z,5R,6R,14aR,14bR)-
- [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-5,6-dimethyl-, [5R-(3Z,5R*,6R*,14aR*,14bR*)]-