CAS 2318-18-5: Senkirkine
Description:Senkirkine, with the CAS number 2318-18-5, is a naturally occurring alkaloid primarily derived from the plant species of the genus *Senkirkia*. This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Senkirkine exhibits a range of pharmacological properties, including potential anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry and pharmacology. Its solubility profile typically indicates moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as pH and temperature. Additionally, senkirkine's interactions with biological systems are an area of ongoing research, particularly regarding its mechanism of action and potential therapeutic applications. As with many alkaloids, safety and toxicity profiles are crucial for its use in any medicinal context, necessitating thorough investigation in preclinical and clinical studies. Overall, senkirkine represents a fascinating subject for further exploration in both natural product chemistry and drug development.
Formula:C19H27NO6
InChI:InChI=1S/C19H27NO6/c1-5-13-10-12(2)19(3,24)18(23)25-11-14-6-8-20(4)9-7-15(16(14)21)26-17(13)22/h5-6,12,15,24H,7-11H2,1-4H3/b13-5-,14-6?/t12-,15-,19-/m1/s1
InChI key:InChIKey=HPDHKHMHQGCNPE-QESVCWQLSA-N
SMILES:O=C1OC2C(=O)C(=CCN(C)CC2)COC(=O)C(O)(C)C(C)CC1=CC
- Synonyms:
- 4,8-Secosenecionan-8,11,16-trione, 12-hydroxy-4-methyl-
- (1R,4Z,6R,7R)-4-Ethylidene-7-hydroxy-6,7,14-trimethyl-2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione
- 2,3,5,7a-Tetrahydro-1,7a-dihydroxy-7-(hydroxymethyl)-4-methyl-1H-pyrrolizinium hydroxide, inner salt, cyclic diester with senecic acid
- 2,9-Dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione, 4-ethylidene-7-hydroxy-6,7,14-trimethyl-, (1R,4Z,6R,7R)-
- Renardine (neutral)
- See more synonyms
