CAS 33693-04-8: Terbumeton
Description:Terbumeton, with the CAS number 33693-04-8, is a selective herbicide primarily used in agricultural settings for the control of certain broadleaf weeds and grasses. It belongs to the chemical class of benzenesulfonamides and functions by inhibiting specific enzymatic pathways in plants, disrupting their growth and development. Terbumeton is characterized by its systemic action, allowing it to be absorbed by plant roots and foliage, leading to effective weed management. It is typically applied pre-emergence or post-emergence, depending on the target weeds and crop type. The substance is known for its relatively low toxicity to mammals and birds, making it a preferred choice in integrated pest management strategies. However, like many herbicides, it requires careful handling and application to minimize environmental impact and prevent resistance development in weed populations. Proper safety measures and adherence to regulatory guidelines are essential when using Terbumeton in agricultural practices.
Formula:C10H19N5O
InChI:InChI=1S/C10H19N5O/c1-6-11-7-12-8(15-10(2,3)4)14-9(13-7)16-5/h6H2,1-5H3,(H2,11,12,13,14,15)
InChI key:InChIKey=BCQMBFHBDZVHKU-UHFFFAOYSA-N
SMILES:N=1C(=NC(=NC1NCC)NC(C)(C)C)OC
- Synonyms:
- 2-Methoxy-4-ethylamino-6-tert-butylamino-s-triazine
- 1,3,5-Triazine-2,4-diamine, N2-(1,1-dimethylethyl)-N4-ethyl-6-methoxy-
- N2-(1,1-Dimethylethyl)-N4-ethyl-6-methoxy-1,3,5-triazine-2,4-diamine
- s-Triazine, 2-(tert-butylamino)-4-(ethylamino)-6-methoxy-
- 1,3,5-Triazine-2,4-diamine, N-(1,1-dimethylethyl)-N′-ethyl-6-methoxy-
