CAS 520-68-3
:(+)-Echimidine
Description:
(+)-Echimidine, with the CAS number 520-68-3, is a naturally occurring alkaloid primarily derived from the plant species of the genus *Echium*. This compound is characterized by its complex bicyclic structure, which contributes to its biological activity. It typically appears as a white to off-white crystalline solid and is known for its potential pharmacological properties, including effects on the central nervous system. (+)-Echimidine exhibits stereochemistry, which is crucial for its interaction with biological targets, influencing its efficacy and potency. The compound is soluble in organic solvents, but its solubility in water is limited. Its chemical behavior is influenced by the presence of functional groups, which can participate in various chemical reactions. Research into (+)-Echimidine has highlighted its potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, further studies are necessary to fully understand its mechanisms of action and potential side effects. As with many alkaloids, safety and toxicity profiles are essential considerations in its application.
Formula:C20H31NO7
InChI:InChI=1S/C20H31NO7/c1-6-12(2)17(23)28-15-8-10-21-9-7-14(16(15)21)11-27-18(24)20(26,13(3)22)19(4,5)25/h6-7,13,15-16,22,25-26H,8-11H2,1-5H3/b12-6-/t13-,15+,16+,20-/m0/s1
InChI key:InChIKey=HRSGCYGUWHGOPY-LYHHMGRNSA-N
SMILES:C(OC([C@]([C@@](C)(C)O)([C@H](C)O)O)=O)C=1[C@]2(N(CC[C@H]2OC(/C(=C\C)/C)=O)CC1)[H]
Synonyms:- L-threo-Pentitol, 1,5-dideoxy-2-C-methyl-3-C-[[[(1R,7aR)-2,3,5,7a-tetrahydro-1-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]-1H-pyrrolizin-7-yl]methoxy]carbonyl]-
- (+)-Echimidine
- Echimidine
- L-threo-Pentitol, 1,5-dideoxy-2-C-methyl-3-C-[[[(1R,7aR)-2,3,5,7a-tetrahydro-1-[[(2Z)-2-methyl-1-oxo-2-butenyl]oxy]-1H-pyrrolizin-7-yl]methoxy]carbonyl]-
- (1R,7aR)-7-[({(2R)-2,3-Dihydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoyl}oxy)methyl]-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl (2Z)-2-methylbut-2-enoate (non-preferred name)
- 1,5-Dideoxy-2-C-methyl-3-C-[[[(1R,7aR)-2,3,5,7a-tetrahydro-1-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]-1H-pyrrolizin-7-yl]methoxy]carbonyl]-L-threo-pentitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Echimidine
CAS:Natural alkaloid
Formula:C20H31NO7Purity:≥ 90.0 % (HPLC)Color and Shape:Viscous liquidMolecular weight:397.47Echimidine
CAS:Echimidine is a natural pyrrolizidine alkaloid and direct AChE inhibitor that also has binding activity to muscarinic receptors and 5-HT2, Alzheimer's disease.Formula:C20H31NO7Purity:98%Color and Shape:SolidMolecular weight:397.46Echimidine 100 µg/mL in Water
CAS:Controlled ProductFormula:C20H31NO7Color and Shape:Single SolutionMolecular weight:397.46Echimidine perchlorate
CAS:Natural alkaloidFormula:C20H31NO7HClO4Purity:≥ 90.0 % (HPLC)Molecular weight:497.92Echimidine
CAS:Echimidine is a pyrrolizidine alkaloid, which is a natural compound extracted from certain species in the Boraginaceae plant family. It is specifically sourced from various Echium species, commonly found in Mediterranean regions. The mode of action of Echimidine involves its biotransformation within the liver to reactive metabolites that can interact with cellular macromolecules, potentially leading to cytotoxic and genotoxic effects.Formula:C20H31NO7Purity:90%MinColor and Shape:PowderMolecular weight:397.46 g/mol






