CAS 6209-65-0: Heliotrine, N-oxide
Description:Heliotrine, N-oxide, with the CAS number 6209-65-0, is a chemical compound derived from heliotrine, which is a pyrrolizidine alkaloid. This substance is characterized by its structural features, including a nitrogen atom in the form of an N-oxide, which influences its reactivity and biological activity. Heliotrine, N-oxide is typically a colorless to pale yellow solid or liquid, depending on its purity and specific conditions. It is known for its potential biological effects, including toxicity, which is a common concern with many pyrrolizidine alkaloids due to their ability to form reactive metabolites. The compound may exhibit various pharmacological properties, but its use is often limited due to safety concerns. In terms of solubility, it is generally soluble in organic solvents, which is typical for many alkaloids. As with any chemical substance, handling precautions should be observed, particularly due to its potential health risks.
Formula:C16H27NO6
InChI:InChI=1S/C16H27NO6/c1-10(2)16(20,11(3)22-4)15(19)23-9-12-5-7-17(21)8-6-13(18)14(12)17/h5,10-11,13-14,18,20H,6-9H2,1-4H3/t11-,13+,14-,16+,17?/m1/s1
InChI key:InChIKey=QSTHEUSPIBEICI-MCAMCBDESA-N
SMILES:O=C(OCC1=CCN2(=O)CCC(O)C12)C(O)(C(OC)C)C(C)C
- Synonyms:
- Butanoic acid, 2-hydroxy-2-[(1R)-1-methoxyethyl]-3-methyl-, [(1S,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-4-oxido-1H-pyrrolizin-7-yl]methyl ester, (2S)-
- Heliotrine, 4-oxide
- Heliotrine oxide
- Heliotrine, N-oxide
- Butanoic acid, 2-hydroxy-2-(1-methoxyethyl)-3-methyl-, (2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl)methyl ester, N-oxide, [1S-[1α,7[R*(S*)],7aα]]-
