CAS 65582-53-8

(1-hydroxy-4-oxido-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl)methyl 2,3-dihydroxy-2-(1-methoxyethyl)-3-methylbutanoate (non-preferred name)

Description:

The chemical substance known as (1-hydroxy-4-oxido-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl)methyl 2,3-dihydroxy-2-(1-methoxyethyl)-3-methylbutanoate, with the CAS number 65582-53-8, is a complex organic compound characterized by its unique structural features. It contains a pyrrolizine ring, which contributes to its cyclic nature and potential biological activity. The presence of multiple hydroxyl groups indicates that it may exhibit significant polarity, potentially influencing its solubility and reactivity. The methoxyethyl group suggests that it may have ether characteristics, which can affect its interaction with other molecules. This compound may also possess functional groups that allow for hydrogen bonding, enhancing its potential for biological interactions. Given its intricate structure, it may be of interest in medicinal chemistry or as a synthetic intermediate. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. Overall, this compound exemplifies the complexity often found in organic chemistry, particularly in the context of bioactive molecules.

Formula: C₁₆H₂₇NO₇

InChI: InChI=1/C16H27NO7/c1-10(23-4)16(21,15(2,3)20)14(19)24-9-11-5-7-17(22)8-6-12(18)13(11)17/h5,10,12-13,18,20-21H,6-9H2,1-4H3

SMILES: CC(C(C(=O)OCC1=CCN2(=O)CCC(C12)O)(C(C)(C)O)O)OC

Europine-N-oxide 100 µg/mL in Water

Controlled Product

CAS: 65582-53-8

Formula: C₁₆H₂₇NO₇

Color and Shape: Single Solution

Molecular weight: 345.388

Ref: 04-A13398010WA-100

Pyrrolizidine alkaloids Mixture 661 100 µg/mL in Methanol

Controlled Product

CAS: 101687-28-9, 10285-06-0, 10285-07-1, 127-30-0, 130-01-8, 13268-67-2, 15503-86-3, 2318-18-5, 303-33-3, 303-34-4, 38710-26-8, 41093-89-4, 480-54-6, 480-81-9, 520-68-3, 570-19-4, 6209-65-0, 65582-53-8, 72755-25-0, 95462-14-9, 95462-15-0

Color and Shape: Mixture

Ref: 04-A50000661ME

Europine N-Oxide

CAS: 65582-53-8

Formula: C₁₆H₂₇NO₇

Molecular weight: 345.39

Ref: 4Z-E-162003

Europine n-oxide

CAS: 65582-53-8

Natural alkaloid

Formula: C₁₆H₂₇NO₇

Purity: ≥ 98.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 345.39

Ref: 5G-83238

Europine N-oxide

Controlled Product

CAS: 65582-53-8

Formula: C₁₆H₂₇NO₇

Color and Shape: Neat

Molecular weight: 345.388

Ref: TR-E649945

Europine N-oxide

CAS: 65582-53-8

Europine N-oxide is a semi-synthetic chemical compound which originates from modified alkaloids found in various species of the pine tree. This compound is synthesized by oxidizing naturally occurring europine to produce the N-oxide form, which exhibits distinct physicochemical properties compared to its precursor. The mode of action involves interaction with specific biological targets, potentially influencing neural pathways and cellular processes, although the precise mechanisms can vary depending on the experimental context.

Formula: C₁₆H₂₇NO₇

Purity: Min. 95%

Color and Shape: Colorless Powder

Molecular weight: 345.39 g/mol

Ref: 3D-FE161601

Europine-N-Oxide

CAS: 65582-53-8

Formula: C₁₆H₂₇NO₇

Molecular weight: 345.4

Ref: ST-EA-CP-E115001