CAS 987-24-6

Betamethasone acetate

Description:

Betamethasone acetate is a synthetic corticosteroid with anti-inflammatory and immunosuppressive properties, commonly used in various medical applications. It is characterized by its ability to inhibit the release of inflammatory mediators, making it effective in treating conditions such as allergies, skin disorders, and certain autoimmune diseases. The substance is typically administered topically, intramuscularly, or via other routes depending on the condition being treated. Betamethasone acetate is a white to off-white crystalline powder that is practically insoluble in water but soluble in organic solvents. Its chemical structure features a steroid backbone with specific functional groups that contribute to its pharmacological activity. The compound is often formulated in combination with other agents to enhance its therapeutic effects. Due to its potency, careful dosing and monitoring are essential to minimize potential side effects, such as adrenal suppression or increased susceptibility to infections. Overall, Betamethasone acetate is a valuable medication in the field of medicine, particularly in managing inflammatory and allergic conditions.

Formula:C₂₄H₃₁FO₆

InChI:InChI=1S/C24H31FO6/c1-13-9-18-17-6-5-15-10-16(27)7-8-21(15,3)23(17,25)19(28)11-22(18,4)24(13,30)20(29)12-31-14(2)26/h7-8,10,13,17-19,28,30H,5-6,9,11-12H2,1-4H3/t13-,17-,18-,19-,21-,22-,23-,24-/m0/s1

InChI key:InChIKey=AKUJBENLRBOFTD-QZIXMDIESA-N

SMILES:C[C@@]12[C@]([C@]3([C@@](F)([C@]4(C)C(CC3)=CC(=O)C=C4)[C@@H](O)C1)[H])(C[C@H](C)[C@@]2(C(COC(C)=O)=O)O)[H]

Synonyms:

(11Beta,16Beta)-9-Fluoro-11,17-Dihydroxy-16-Methyl-3,20-Dioxopregna-1,4-Dien-21-Yl Acetate
(11β,16β)-21-(Acetyloxy)-9-fluoro-11,17-dihydroxy-16-methylpregna-1,4-diene-3,20-dione
(8Xi,10Xi,11Beta,13Xi,16Beta)-9-Fluoro-11,17-Dihydroxy-16-Methyl-3,20-Dioxopregna-1,4-Dien-21-Yl Acetate
21-Acetoxy-9α-fluoro-11β,17α-dihydroxy-16β-methylpregna-1,4-diene-3,20-dione
9-Fluoro-11β,17,21-trihydroxy-16β-methylpregna-1,4-diene-3,20-dione 21-acetate
Betamethasone Acetate
Pregna-1,4-diene-3,20-dione, 21-(acetyloxy)-9-fluoro-11,17-dihydroxy-16-methyl-, (11β,16β)-
Pregna-1,4-diene-3,20-dione, 9-fluoro-11β,17,21-trihydroxy-16β-methyl-, 21-acetate