CAS 175217-20-6: Silthiofam
Description:Silthiofam is a chemical compound classified as a fungicide, primarily used in agricultural applications to control various fungal diseases in crops. It belongs to the class of thiophene derivatives and is characterized by its unique molecular structure, which includes a thiophene ring and a thiazole moiety. Silthiofam exhibits systemic properties, allowing it to be absorbed by plants and translocated to different parts, providing effective protection against pathogens. Its mode of action involves inhibiting the biosynthesis of ergosterol, a vital component of fungal cell membranes, thereby disrupting fungal growth and reproduction. The compound is known for its broad-spectrum efficacy against a range of fungal pathogens, making it valuable in crop management. Additionally, Silthiofam has been evaluated for its environmental impact and safety profile, with studies indicating a relatively low toxicity to non-target organisms when used according to recommended guidelines. As with any agrochemical, proper handling and application practices are essential to maximize its effectiveness while minimizing potential risks to human health and the environment.
Formula:C13H21NOSSi
InChI:InChI=1S/C13H21NOSSi/c1-7-8-14-12(15)11-9(2)10(3)16-13(11)17(4,5)6/h7H,1,8H2,2-6H3,(H,14,15)
InChI key:InChIKey=MXMXHPPIGKYTAR-UHFFFAOYSA-N
SMILES:O=C(NCC=C)C1=C(SC(=C1C)C)[Si](C)(C)C
- Synonyms:
- 3-Thiophenecarboxamide, 4,5-dimethyl-N-2-propen-1-yl-2-(trimethylsilyl)-
- 3-Thiophenecarboxamide, 4,5-dimethyl-N-2-propenyl-2-(trimethylsilyl)-
- 4,5-Dimethyl-N-2-propen-1-yl-2-(trimethylsilyl)-3-thiophenecarboxamide
- 4,5-dimethyl-N-prop-2-en-1-yl-2-(trimethylsilyl)thiophene-3-carboxamide
- Latitude
- Latitude (fungicide)
- Mon 65500
- Mon65500
- N-Allyl-4,5-dimethyl-2-trimethylsilylthiophene-3-carboxamide
- N-allyl-4,5-dime-thyl-2-(trimethylsilyl)thiophene-3-carboxamide
- See more synonyms
- Silthiofam (Bsi,Iso)
- Silthiopham
- Silthiophenamide
