CymitQuimica logo

CAS 61592-45-8

:

N-Methylbentazon

Description:
N-Methylbentazon is a selective herbicide primarily used for controlling broadleaf weeds in various crops, particularly in rice and soybeans. It belongs to the chemical class of benzothiadiazines and functions by inhibiting photosynthesis in target plants. The compound is characterized by its relatively low solubility in water, which influences its application and environmental behavior. N-Methylbentazon is typically applied post-emergence, allowing it to effectively target weeds without harming the crops. Its mode of action involves disrupting the electron transport chain in chloroplasts, leading to the eventual death of the weed. The substance is generally considered to have low toxicity to mammals, but like many herbicides, it requires careful handling to minimize environmental impact and potential effects on non-target organisms. Additionally, its persistence in soil can vary based on environmental conditions, which is an important consideration for agricultural practices. Overall, N-Methylbentazon is valued for its effectiveness in weed management while necessitating responsible usage to safeguard ecosystems.
Formula:C11H14N2O3S
InChI:InChI=1S/C11H14N2O3S/c1-8(2)13-11(14)9-6-4-5-7-10(9)12(3)17(13,15)16/h4-8H,1-3H3
InChI key:InChIKey=XFTQFXBQDVWOCY-UHFFFAOYSA-N
SMILES:CN1C=2C(C(=O)N(C(C)C)S1(=O)=O)=CC=CC2
Synonyms:
  • N-Methylbentazon
  • 1H-2,1,3-Benzothiadiazin-4(3H)-one, 1-methyl-3-(1-methylethyl)-, 2,2-dioxide
  • BAS 79520
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 6 products.