CAS 950782-86-2: Indaziflam
Description:Indaziflam is a selective herbicide primarily used for the control of annual grasses and certain broadleaf weeds in various crops and non-crop areas. It belongs to the class of chemicals known as benzamide derivatives and functions by inhibiting the biosynthesis of cellulose, which is crucial for plant cell wall formation. This mode of action disrupts the growth of targeted weeds while having minimal impact on established crops. Indaziflam is characterized by its low water solubility, which contributes to its effectiveness in soil applications, allowing it to persist and provide extended weed control. It is typically applied pre-emergence, meaning it is used before the weeds germinate. The substance is known for its relatively low toxicity to non-target organisms, making it a more environmentally friendly option compared to some traditional herbicides. Additionally, it has a favorable profile in terms of its degradation in the environment, which helps mitigate potential long-term ecological impacts. Overall, Indaziflam represents a modern approach to weed management in agricultural practices.
Formula:C16H20FN5
InChI:InChI=1S/C16H20FN5/c1-8-4-5-11-7-9(2)13(12(11)6-8)19-16-21-14(10(3)17)20-15(18)22-16/h4-6,9-10,13H,7H2,1-3H3,(H3,18,19,20,21,22)/t9-,10?,13+/m0/s1
InChI key:InChIKey=YFONKFDEZLYQDH-BOURZNODSA-N
SMILES:FC(C=1N=C(N=C(N1)NC2C3=CC(=CC=C3CC2C)C)N)C
- Synonyms:
- 1,3,5-Triazine-2,4-diamine, N<sup>2</sup>-[(1R,2S)-2,3-dihydro-2,6-dimethyl-1H-inden-1-yl]-6-(1-fluoroethyl)-
- 1,3,5-triazine-2,4-diamine, N2
- 950782-86-2
- Esplanade
- Esplanade 200SC
- Esplanade F
- Indaziflam
- Marengo
- N<sup>2</sup>-[(1R,2S)-2,3-Dihydro-2,6-dimethyl-1H-inden-1-yl]-6-(1-fluoroethyl)-1,3,5-triazine-2,4-diamine
- Specticle
- See more synonyms
- Specticle 20WSP
- 1,3,5-Triazine-2,4-diamine, N2-[(1R,2S)-2,3-dihydro-2,6-dimethyl-1H-inden-1-yl]-6-(1-fluoroethyl)-
- N2-[(1R,2S)-2,3-Dihydro-2,6-dimethyl-1H-inden-1-yl]-6-(1-fluoroethyl)-1,3,5-triazine-2,4-diamine
LC PestiMix 7 10 µg/mL in Acetonitrile
Ref: 04-A50000807AL
| 1ml | To inquire |
Indaziflam
Controlled ProductRef: 04-C14288300
| 100mg | 319.00 € |
PestiMix 4 5 μg/mL in Acetonitrile:Acetone (72:13.5)
Controlled ProductRef: 04-A50000085AA
| 1ml | 1,287.00 € |
Indaziflam 100 µg/mL in Acetonitrile
Ref: 04-A14288300AL-100
| 1ml | To inquire |
