CAS 135186-78-6: Pyriftalid
Description:Pyriftalid, with the CAS number 135186-78-6, is a chemical compound classified as a herbicide. It belongs to the class of substances known as pyridazinones and is primarily used for the control of various weeds in agricultural settings. Pyriftalid exhibits selective herbicidal activity, targeting specific plant species while minimizing harm to crops. Its mode of action typically involves the inhibition of photosynthesis, leading to the eventual death of the targeted weeds. The compound is characterized by its relatively low toxicity to mammals and birds, making it a safer option for use in agricultural practices. Additionally, Pyriftalid is known for its stability in the environment, which contributes to its effectiveness as a long-lasting herbicide. However, as with any chemical substance, proper handling and application are essential to mitigate potential environmental impacts and ensure safety. Overall, Pyriftalid represents a valuable tool in integrated weed management strategies, promoting sustainable agricultural practices.
Formula:C15H14N2O4S
InChI:InChI=1S/C15H14N2O4S/c1-8-9-5-4-6-10(13(9)14(18)21-8)22-15-16-11(19-2)7-12(17-15)20-3/h4-8H,1-3H3
InChI key:InChIKey=RRKHIAYNPVQKEF-UHFFFAOYSA-N
SMILES:O=C1OC(C=2C=CC=C(SC=3N=C(OC)C=C(N3)OC)C12)C
- Synonyms:
- (RS)-7-(4,6-dimethyoxypryimidin-2-ylthio)-3-methyl-2-benzofuran-1 (3H)-one
- 1(3H)-Isobenzofuranone, 7-[(4,6-dimethoxy-2-pyrimidinyl)thio]-3-methyl-
- 7-(4,6-Dimethoxypyrimidin-2-ylthio)-3-methylphthalide
- 7-(4,6-Dimethoxypyrimin-2-Ylthio)-3-Methylisobenzofuran-1(3H)-One
- 7-[(4,6-Dimethoxy-2-pyrimidinyl)thio]-3-methyl-1(3H)-isobenzofuranone
- 7-[(4,6-dimethoxypyrimidin-2-yl)sulfanyl]-3-methyl-2-benzofuran-1(3H)-one
- Cga 279233
- Graminicide
- Huanzhicaomi
- Pyriftalid (Bsi, Pa Iso)
- See more synonyms
- Pyriftalid, Pestanal
- Pyriftalid

LC PestiMix 9 10 µg/mL in Acetonitrile
Ref: 04-A50000809AL
1ml | To inquire |

Pyriftalid
Controlled ProductRef: 04-C16656000
100mg | 98.00 € |

Pyriftalid 100 µg/mL in Acetonitrile
Ref: 04-A16656000AL-100
1ml | To inquire |

GB 23200.121-2021 Pesticide Mixture 8 50 µg/mL in Acetonitrile:Methanol
Controlled ProductRef: 04-A50000728MC
Undefined size | To inquire |

Pyriftalid
Ref: TM-T201213
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |