CymitQuimica logo

CAS 221205-90-9

:

N-{2-[(4,6-dimethoxypyrimidin-2-yl)(hydroxy)methyl]-6-(methoxymethyl)phenyl}-1,1-difluoromethanesulfonamide

Description:
N-{2-[(4,6-dimethoxypyrimidin-2-yl)(hydroxy)methyl]-6-(methoxymethyl)phenyl}-1,1-difluoromethanesulfonamide is a complex organic compound characterized by its unique structural features, including a pyrimidine ring and a sulfonamide functional group. The presence of multiple methoxy groups contributes to its solubility and potential reactivity, while the difluoromethanesulfonamide moiety may enhance its biological activity. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential applications in areas such as enzyme inhibition or as a therapeutic agent. Additionally, the presence of hydroxymethyl and difluoromethyl groups may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Overall, this compound exemplifies the intricate design often found in drug development, where modifications to the molecular framework can significantly impact biological efficacy and safety profiles.
Formula:C16H19F2N3O6S
InChI:InChI=1/C16H19F2N3O6S/c1-25-8-9-5-4-6-10(13(9)21-28(23,24)16(17)18)14(22)15-19-11(26-2)7-12(20-15)27-3/h4-7,14,16,21-22H,8H2,1-3H3
SMILES:COCc1cccc(c1NS(=O)(=O)C(F)F)C(c1nc(cc(n1)OC)OC)O
Synonyms:
  • 221205-90-9
Found 5 products.