CAS 5836-29-3: Counmatetralyl
Description:Counmatetralyl is a chemical compound classified as a rodenticide, primarily used for controlling rodent populations. It belongs to the anticoagulant class of compounds, which function by inhibiting vitamin K epoxide reductase, leading to a disruption in the synthesis of clotting factors and ultimately causing internal bleeding in rodents. This substance is typically presented in bait formulations, making it effective for pest control in various environments. Counmatetralyl is characterized by its relatively low toxicity to non-target species when used according to label directions, although it can pose risks to wildlife and pets if ingested in significant amounts. Its mode of action is cumulative, meaning that repeated exposure over time can lead to toxicity. The compound is generally stable under normal conditions but should be stored in a cool, dry place away from incompatible substances. As with all pesticides, proper handling and adherence to safety guidelines are essential to minimize risks to humans and the environment.
Formula:C19H16O3
InChI:InChI=1S/C19H16O3/c20-18-15-9-3-4-11-16(15)22-19(21)17(18)14-10-5-7-12-6-1-2-8-13(12)14/h1-4,6,8-9,11,14,20H,5,7,10H2
InChI key:InChIKey=ULSLJYXHZDTLQK-UHFFFAOYSA-N
SMILES:O=C1OC=2C=CC=CC2C(O)=C1C3C=4C=CC=CC4CCC3
- Synonyms:
- 2-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-4H-chromen-4-one
- 2H-1-Benzopyran-2-one, 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthalenyl)-
- 3-(1,2,3,4-Tetrahydro-1-naphthyl)-4-hydroxycoumarin
- 3-(α-Tetralinyl)-4-hydroxycoumarin
- 3-(α-Tetralyl)-4-Hydroxycoumarin
- 4-Hydroxy-3-(1,2,3,4-tetrahydro-1-naphthalenyl)-2H-1-benzopyran-2-one
- 4-Hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)coumarin
- 4-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-2H-chromen-2-one
- Coumarin, 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)-
- Coumatetralyl
- See more synonyms
- Endrocide
- Murisan A
- Racumin
- Racumin 57
- Rodentin
