CAS 156963-66-5: Benzobicyclon
Description:Benzobicyclon, with the CAS number 156963-66-5, is a chemical compound that belongs to the class of bicyclic compounds. It features a fused bicyclic structure that incorporates a benzene ring, which contributes to its stability and unique chemical properties. This compound is primarily recognized for its application in the field of herbicides, particularly in agricultural practices, where it acts as a selective herbicide targeting specific weed species while minimizing damage to crops. Benzobicyclon exhibits a moderate level of lipophilicity, which influences its absorption and distribution in biological systems. Its mode of action typically involves the inhibition of certain biochemical pathways in plants, leading to growth disruption. Additionally, the compound's environmental persistence and potential effects on non-target organisms are important considerations in its use. As with many chemical substances, safety data sheets should be consulted for handling, storage, and disposal guidelines to ensure safe usage in both laboratory and field settings.
Formula:C22H19ClO4S2
InChI:InChI=1S/C22H19ClO4S2/c1-29(26,27)16-9-10-17(18(23)12-16)21(25)19-20(24)13-7-8-14(11-13)22(19)28-15-5-3-2-4-6-15/h2-6,9-10,12-14H,7-8,11H2,1H3
InChI key:InChIKey=VIXCLRUCUMWJFF-UHFFFAOYSA-N
SMILES:O=C(C1=CC=C(C=C1Cl)S(=O)(=O)C)C=2C(=O)C3CCC(C2SC=4C=CC=CC4)C3
- Synonyms:
- 3-[2-Chloro-4-(Methylsulfonyl)Benzoyl]-4-(Phenylsulfanyl)Bicyclo[3.2.1]Oct-3-En-2-One
- 3-[2-Chloro-4-(methylsulfonyl)benzoyl]-4-(phenylthio)bicyclo[3.2.1]oct-3-en-2-one
- Benzobicyclon
- Benzobicyclon (Bsi, Pa Iso)
- Benzobicyclon Standard
- Bicyclo[3.2.1]oct-3-en-2-one, 3-[2-chloro-4-(methylsulfonyl)benzoyl]-4-(phenylthio)-
- SB 500 (herbicide)
- Sb 500
![Bicyclo[3.2.1]oct-3-en-2-one, 3-[2-chloro-4-(methylsulfonyl)benzoyl]-4-(phenylthio)-](https://static.cymitquimica.com/products/IN/thumb/DA001P3U.jpg)
