CAS 500207-04-5: Picarbutrazox
Description:Picarbutrazox is a chemical compound classified as a fungicide, primarily used in agricultural applications to control various fungal diseases in crops. It belongs to the class of compounds known as triazoles, which are characterized by a five-membered ring containing three nitrogen atoms. Picarbutrazox exhibits a unique mode of action that inhibits the biosynthesis of ergosterol, an essential component of fungal cell membranes, thereby disrupting fungal growth and reproduction. The compound is typically applied as a foliar spray and is known for its effectiveness against a range of pathogens. Its chemical structure contributes to its stability and efficacy, making it a valuable tool in integrated pest management strategies. Additionally, Picarbutrazox has been studied for its environmental impact and safety profile, ensuring that it meets regulatory standards for use in agriculture. As with any chemical substance, proper handling and application are crucial to minimize potential risks to human health and the environment.
Formula:C20H23N7O3
InChI:InChI=1S/C20H23N7O3/c1-20(2,3)30-19(28)22-16-12-8-11-15(21-16)13-29-24-17(14-9-6-5-7-10-14)18-23-25-26-27(18)4/h5-12H,13H2,1-4H3,(H,21,22,28)/b24-17-
InChI key:InChIKey=URHWNXDZOULUHC-ULJHMMPZSA-N
SMILES:O=C(OC(C)(C)C)NC=1N=C(C=CC1)CON=C(C2=NN=NN2C)C=3C=CC=CC3
- Synonyms:
- Carbamic acid, N-[6-[[[(Z)-[(1-methyl-1H-tetrazol-5-yl)phenylmethylene]amino]oxy]methyl]-2-pyridinyl]-, 1,1-dimethylethyl ester
- Picarbutrazox
- Carbamic acid, [6-[[[(Z)-[(1-methyl-1H-tetrazol-5-yl)phenylmethylene]amino]oxy]methyl]-2-pyridinyl]-, 1,1-dimethylethyl ester
- NF 171
- tert-Butyl N-[6-[[(Z)-[(1-methyltetrazol-5-yl)phenylmethylene]amino]oxymethyl]-2-pyridyl]carbamate
