CAS 926914-55-8: Pyflubumide
Description:Pyflubumide, with the CAS number 926914-55-8, is a chemical compound that belongs to the class of pyridine derivatives. It is primarily recognized for its application as a pesticide, particularly in agricultural settings, where it serves as an insecticide and acaricide. Pyflubumide exhibits a unique mode of action, targeting specific neurophysiological pathways in pests, which helps in controlling various insect populations effectively. The compound is characterized by its relatively low toxicity to non-target organisms, making it a more environmentally friendly option compared to traditional pesticides. Additionally, Pyflubumide is known for its stability and efficacy, which contribute to its prolonged activity in pest management. Its chemical structure includes functional groups that enhance its biological activity, allowing for effective penetration and action within the target organisms. As with any chemical substance, proper handling and adherence to safety guidelines are essential to mitigate any potential risks associated with its use.
Formula:C25H31F6N3O3
InChI:InChI=1S/C25H31F6N3O3/c1-13(2)11-17-12-18(9-10-19(17)23(37-8,24(26,27)28)25(29,30)31)34(21(35)14(3)4)22(36)20-15(5)32-33(7)16(20)6/h9-10,12-14H,11H2,1-8H3
InChI key:InChIKey=DZVWKNFPXMUIFA-UHFFFAOYSA-N
SMILES:O=C(C=1C(=NN(C1C)C)C)N(C(=O)C(C)C)C2=CC=C(C(=C2)CC(C)C)C(OC)(C(F)(F)F)C(F)(F)F
- Synonyms:
- Pyflubumide
- 1,3,5-Trimethyl-N-(2-methyl-1-oxopropyl)-N-[3-(2-methylpropyl)-4-[2,2,2-trifluoro-1-methoxy-1-(trifluoromethyl)ethyl]phenyl]-1H-pyrazole-4-carboxamide
- N-[3-Isobutyl-4-[2,2,2-trifluoro-1-methoxy-1-(trifluoromethyl)ethyl]phenyl]-N-isobutyryl-1,3,5-trimethyl-pyrazole-4-carboxamide
- 1H-Pyrazole-4-carboxamide, 1,3,5-trimethyl-N-(2-methyl-1-oxopropyl)-N-[3-(2-methylpropyl)-4-[2,2,2-trifluoro-1-methoxy-1-(trifluoromethyl)ethyl]phenyl]-
