CAS 352010-68-5: Bicyclopyrone
Description:Bicyclopyrone, identified by its CAS number 352010-68-5, is a synthetic chemical compound belonging to the class of pyrone derivatives. It is characterized by its bicyclic structure, which contributes to its unique chemical properties. Bicyclopyrone is primarily recognized for its herbicidal activity, making it useful in agricultural applications for controlling various weeds. The compound exhibits a selective mode of action, targeting specific plant species while minimizing harm to desirable crops. Its mechanism of action typically involves the inhibition of certain enzymatic pathways essential for plant growth. Bicyclopyrone is generally stable under standard conditions, but like many organic compounds, it may be sensitive to extreme pH levels or high temperatures. Additionally, its solubility and bioavailability can vary based on environmental factors, influencing its effectiveness as a herbicide. Overall, bicyclopyrone represents a significant advancement in the development of selective herbicides, contributing to more sustainable agricultural practices.
Formula:C19H20F3NO5
InChI:InChI=1S/C19H20F3NO5/c1-27-6-7-28-9-13-12(4-5-14(23-13)19(20,21)22)18(26)15-16(24)10-2-3-11(8-10)17(15)25/h4-5,10-11,24H,2-3,6-9H2,1H3
InChI key:InChIKey=HUYBEDCQLAEVPD-UHFFFAOYSA-N
SMILES:O=C(C=1C=CC(=NC1COCCOC)C(F)(F)F)C=2C(=O)C3CCC(C2O)C3
- Synonyms:
- 352010-68-5
- 4-Hydroxy-3-[[2-[(2-methoxyethoxy)methyl]-6-(trifluoromethyl)-3-pyridinyl]carbonyl]bicyclo[3.2.1]oct-3-en-2-one
- Bicyclo[3.2.1]oct-3-en-2-one, 4-hydroxy-3-[[2-[(2-methoxyethoxy)methyl]-6-(trifluoromethyl)-3-pyridinyl]carbonyl]-
- Bicyclopyrone
