CAS 366815-39-6: Fenaminstrobin
Description:Fenaminstrobin is a chemical compound classified as a fungicide, primarily used in agriculture to control various fungal diseases in crops. It belongs to the class of strobilurin fungicides, which are known for their broad-spectrum activity and mode of action that inhibits mitochondrial respiration in fungi. Fenaminstrobin is characterized by its systemic properties, allowing it to be absorbed and translocated within plants, providing effective protection against pathogens. The compound typically exhibits low toxicity to mammals and beneficial organisms, making it a preferred choice in integrated pest management. Its chemical structure includes a distinctive strobilurin backbone, contributing to its efficacy and stability. Fenaminstrobin is often applied as a foliar spray and can be used on a variety of crops, including fruits and vegetables. As with many agricultural chemicals, proper handling and application are essential to minimize environmental impact and ensure safety.
Formula:C21H21Cl2N3O3
InChI:InChI=1S/C21H21Cl2N3O3/c1-14(11-12-17-18(22)9-6-10-19(17)23)25-29-13-15-7-4-5-8-16(15)20(26-28-3)21(27)24-2/h4-12H,13H2,1-3H3,(H,24,27)/b12-11+,25-14+,26-20+
InChI key:InChIKey=RBWGTZRSEOIHFD-UHUFKFKFSA-N
SMILES:O=C(NC)C(=NOC)C=1C=CC=CC1CON=C(C=CC=2C(Cl)=CC=CC2Cl)C
- Synonyms:
- Xiwojunan
- Fenaminostrobin
- (αE)-2-[[[(E)-[(2E)-3-(2,6-Dichlorophenyl)-1-methyl-2-propen-1-ylidene]amino]oxy]methyl]-α-(methoxyimino)-N-methylbenzeneacetamide
- Benzeneacetamide, 2-[[[(E)-[(2E)-3-(2,6-dichlorophenyl)-1-methyl-2-propenylidene]amino]oxy]methyl]-α-(methoxyimino)-N-methyl-, (αE)-
- Benzeneacetamide, 2-[[[(E)-[(2E)-3-(2,6-dichlorophenyl)-1-methyl-2-propen-1-ylidene]amino]oxy]methyl]-α-(methoxyimino)-N-methyl-, (αE)-
