CAS 847749-37-5: Pyrisoxazole
Description:Pyrisoxazole, identified by the CAS number 847749-37-5, is a heterocyclic compound characterized by the presence of a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits properties associated with its structural framework, including potential biological activity and applications in medicinal chemistry. Pyrisoxazole derivatives may demonstrate various pharmacological effects, making them of interest in drug development. The compound's solubility, stability, and reactivity can vary based on substituents attached to the ring, influencing its interactions in biological systems. Pyrisoxazole and its derivatives are often studied for their potential use in treating conditions such as inflammation or infection, owing to their ability to modulate biological pathways. Additionally, the compound's synthesis may involve various organic reactions, including cyclization processes. Overall, pyrisoxazole represents a class of compounds with diverse applications in chemistry and pharmacology, warranting further investigation into its properties and potential uses.
Formula:C16H17ClN2O
InChI:InChI=1S/C16H17ClN2O/c1-16(13-4-3-9-18-11-13)10-15(20-19(16)2)12-5-7-14(17)8-6-12/h3-9,11,15H,10H2,1-2H3
InChI key:InChIKey=DHTJFQWHCVTNRY-UHFFFAOYSA-N
SMILES:ClC1=CC=C(C=C1)C2ON(C)C(C=3C=NC=CC3)(C)C2
- Synonyms:
- 3-[5-(4-Chlorophenyl)-2,3-dimethyl-3-isoxazolidinyl]pyridine
- 3-[5-(4-Chlorophenyl)-2,3-dimethylisooxazolidin-3-yl]pyridine
- 3-[5-(4-Chlorophenyl)-2,3-dimethylisoxazolidin-3-yl]pyridine
- 847749-37-5
- Dingjunezuo
- Jun Si Qi
- Pyridine, 3-[5-(4-chlorophenyl)-2,3-dimethyl-3-isoxazolidinyl]-
- Pyrisoxazole
- Syp-Z 048
- pyrisoxazole Solution, 1000ppm
- See more synonyms
