CAS 862588-11-2: Pyraoxystrobin
Description:Pyraoxystrobin is a fungicide belonging to the strobilurin class of compounds, which are known for their broad-spectrum activity against various fungal pathogens. It operates primarily through the inhibition of mitochondrial respiration, specifically targeting the cytochrome bc1 complex, which disrupts energy production in fungi. This mode of action makes it effective in controlling a range of diseases in crops, including those affecting cereals, fruits, and vegetables. Pyraoxystrobin is characterized by its systemic properties, allowing it to be absorbed and translocated within plants, providing protective and curative effects. It is typically applied as a foliar spray and is valued for its low toxicity to non-target organisms, including humans and beneficial insects, making it a preferred choice in integrated pest management strategies. Additionally, it has a relatively low environmental persistence, which contributes to its favorable profile in agricultural applications. As with all pesticides, proper handling and adherence to safety guidelines are essential to minimize risks to health and the environment.
Formula:C22H21ClN2O4
InChI:InChI=1S/C22H21ClN2O4/c1-25-21(12-20(24-25)15-8-10-17(23)11-9-15)29-13-16-6-4-5-7-18(16)19(14-27-2)22(26)28-3/h4-12,14H,13H2,1-3H3/b19-14+
InChI key:InChIKey=URXNNPCNKVAQRA-XMHGGMMESA-N
SMILES:O=C(OC)C(=COC)C=1C=CC=CC1COC2=CC(=NN2C)C=3C=CC(Cl)=CC3
- Synonyms:
- 862588-11-2
- Benzeneacetic acid, 2-[[[3-(4-chlorophenyl)-1-methyl-1H-pyrazol-5-yl]oxy]methyl]-α-(methoxymethylene)-, methyl ester, (αE)-
- Pyraoxystrobin
- T5NNJ A1 CR DG& EO1R BYVO1& U1O1 & & E Form
