CAS 874967-67-6: Sedaxane
Description:Sedaxane is a chemical compound classified as a fungicide, primarily used in agriculture to control various fungal diseases in crops. It belongs to the class of substances known as succinate dehydrogenase inhibitors (SDHIs), which disrupt the energy production in fungal cells by inhibiting the enzyme succinate dehydrogenase. This mechanism of action makes Sedaxane effective against a broad spectrum of fungal pathogens. The compound is typically applied as a seed treatment or foliar spray, providing both preventive and curative effects. Sedaxane is characterized by its relatively low toxicity to non-target organisms, making it a more environmentally friendly option compared to some traditional fungicides. Its chemical structure includes a unique combination of functional groups that contribute to its efficacy and stability. Additionally, Sedaxane has a favorable environmental profile, with low persistence in soil and water, which reduces the risk of contamination and promotes sustainable agricultural practices. Overall, Sedaxane represents a significant advancement in crop protection technology, offering effective disease management while minimizing ecological impact.
Formula:C18H19F2N3O
InChI:InChI=1S/C18H19F2N3O/c1-23-9-14(16(22-23)17(19)20)18(24)21-15-5-3-2-4-11(15)13-8-12(13)10-6-7-10/h2-5,9-10,12-13,17H,6-8H2,1H3,(H,21,24)
InChI key:InChIKey=XQJQCBDIXRIYRP-UHFFFAOYSA-N
SMILES:O=C(NC=1C=CC=CC1C2CC2C3CC3)C4=CN(N=C4C(F)F)C
- Synonyms:
- 1H-Pyrazole-4-carboxamide, N-(2-[1,1′-bicyclopropyl]-2-ylphenyl)-3-(difluoromethyl)-1-methyl-
- Fuzuohuanjunan
- N-(2-Bicyclopropyl-2-ylphenyl)-3-difluoromethyl-1-methyl-1H-pyrazol-4-carboxylic acid amide
- N-(2-Bicyclopropyl-2-ylphenyl)-3-difluoromethyl-1-methyl-1H-pyrazole-4-carboxamide
- N-[2-(2-(Cyclopropyl)cyclopropyl)phenyl]-3-difluoromethyl-1-methylpyrazole-4-carboxamide
- N-[2-(2-Cyclopropylcyclopropyl)phenyl]-3-difluoromethyl-1-methylpyrazole-4-carboxylic acid amide
- N-[2-[(1R,2R)-2-cyclopropylcyclopropyl]phenyl]-3-(difluoromethyl)-1-methyl-pyrazole-4-carboxamide, N-[2-[(1S,2S)-2-cyclopropylcyclopropyl]phenyl]-3-(difluoromethyl)-1-methyl-pyrazole-4-carboxamide, N-[2-[(1R,2S)-2-cyclopropylcyclopropyl]phenyl]-3-(difluor
- N-[2-[1,1'-bicyclopropyl]-2-ylphenyl]-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide
- N-[2-[1,1′-Bi(cyclopropyl)-2-yl]phenyl]-1-methyl-3-(difluoromethyl)-1H-pyrazole-4-carboxamide
- Vibrance
- See more synonyms
- Vibrance 500FS
- Sedaxane
