
Cyclodextrins
Cyclodextrins are cyclic oligosaccharides derived from starch, known for their unique structure with a hydrophilic exterior and a hydrophobic interior. This enables them to form host-guest complexes with various hydrophobic molecules, improving solubility and stability. Widely utilized in pharmaceuticals, food industries, and environmental applications, our cyclodextrins at CymitQuimica are specially tailored for encapsulation, drug delivery, and enhancing the performance of active ingredients in research and product development.
Found 183 products of "Cyclodextrins"
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
1,1,1-Tris[4-(per-O-methyl-α-cyclodextrin-6-yloxy)phenyl]ethane
Formula:C179H294O90Color and Shape:White to Almost white powder to crystalMolecular weight:3,886.236-Acrylamido-β-cyclodextrin
CAS:Formula:C45H73NO35Purity:>75.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:1,188.055,10,15,20-Tetrakis[3,5-bis(per-O-methyl-α-cyclodextrin-6-yloxy)phenyl]-21H,23H-porphine
Formula:C468H766N4O240Color and Shape:Purple to Dark purple to Brown powder to crystalMolecular weight:10,289.065,10,15,20-Tetrakis[4-(per-O-methyl-α-cyclodextrin-6-yloxy)phenyl]porphyrin
Formula:C256H398N4O120Color and Shape:Orange to Brown to Dark purple powder to crystalMolecular weight:5,451.91Mono-6-(Fmoc-Gln-OtBu)-β-CD
Formula:C66H96N2O39Purity:>85.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,541.476-Amino-6-deoxy-β-cyclodextrin
CAS:Formula:C42H71NO34Purity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:1,134.00α-Cyclodextrin
CAS:Formula:C36H60O30Purity:>98.0%(HPLC)Color and Shape:White powder to crystalMolecular weight:972.85Methyl-β-cyclodextrin (mixture of several Methylated)
CAS:Color and Shape:White to Light yellow to Light red powder to crystalMono-6-O-(p-toluenesulfonyl)-γ-cyclodextrin
CAS:Formula:C55H86O42SPurity:>90.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,451.31γ-Cyclodextrin
CAS:Formula:C48H80O40Purity:>99.0%(HPLC)Color and Shape:White powder to crystalMolecular weight:1,297.13β-Cyclodextrin
CAS:Formula:C42H70O35Purity:>98.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:1,134.992,2-Bis[4-(per-O-methyl-α-cyclodextrin-6-yloxy)phenyl]propane
Formula:C121H200O60Purity:min. 98.0 area%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:2,614.876-Azido-6-deoxy-β-cyclodextrin
CAS:Formula:C42H69N3O34Purity:>95.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:1,160.00(2AS,3AS)-3A-Amino-3A-deoxy-β-cyclodextrin
CAS:Formula:C42H71NO34Purity:>95.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,134.00Mono-6-O-(p-toluenesulfonyl)-α-cyclodextrin
CAS:Formula:C43H66O32SPurity:>85.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,127.03Mono-2-O-(p-toluenesulfonyl)-β-cyclodextrin
CAS:Formula:C49H76O37SPurity:>97.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,289.173A-Amino-3A-deoxy-(2AS,3AS)-α-cyclodextrin
CAS:Formula:C36H61NO29Purity:>90.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:971.86Trimethyl-β-cyclodextrin
CAS:Formula:C63H112O35Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,429.55β-Cyclodextrin
CAS:Formula:C42H70O35Purity:>99.0%(HPLC)Color and Shape:White powder to crystalineMolecular weight:1,134.99Trimethyl-β-cyclodextrin
CAS:Formula:C63H112O35Purity:97%Color and Shape:SolidMolecular weight:1429.5424β-Cyclodextrin, methyl ethers
CAS:Formula:C10H21O5Purity:99%Color and Shape:SolidMolecular weight:221.27072,6-Di-O-methyl-β-cyclodextrin
CAS:Formula:C56H98O35Purity:98%Color and Shape:SolidMolecular weight:1331.3563Ref: IN-DA00ICO9
1kg61.00€25g22.00€50g24.00€5kg153.00€100g26.00€10kgTo inquire20kgTo inquire250g34.00€25kg258.00€500g46.00€50kg680.00€100kgTo inquireTriacetyl-β-cyclodextrin
CAS:Formula:C84H112O56Purity:97%Color and Shape:SolidMolecular weight:2017.7545Ref: IN-DA00CJ7I
1g168.00€5g559.00€50gTo inquire100gTo inquire10mg45.00€250gTo inquire50mg79.00€100mg87.00€250mg130.00€Mono-6-O-(p-toluenesulfonyl)-γ-cyclodextrin
CAS:Formula:C55H86O42SPurity:90.0%Color and Shape:SolidMolecular weight:1451.3111β-Cyclodextrin, 2-hydroxypropyl ethers
CAS:Formula:C63H112O42Purity:98%Color and Shape:SolidMolecular weight:1541.5382Ref: IN-DA000Y45
10gTo inquire1kg114.00€25g20.00€50g28.00€5kg271.00€100g30.00€10kg787.00€20kg1,446.00€250g53.00€25kg1,575.00€500g65.00€Mono-6-O-(p-toluenesulfonyl)-β-cyclodextrin
CAS:Formula:C49H76O37SPurity:95%Color and Shape:SolidMolecular weight:1289.1705Mono-2-O-(p-toluenesulfonyl)-β-cyclodextrin
CAS:Formula:C49H76O37SPurity:97%Color and Shape:SolidMolecular weight:1289.1705β-Cyclodextrin, 6A-amino-6A-deoxy-
CAS:Formula:C42H71NO34Purity:98%Color and Shape:SolidMolecular weight:1133.99946A-Azido-6A-Deoxy-Β-Cyclodextrin
CAS:Formula:C42H69N3O34Purity:85%Color and Shape:SolidMolecular weight:1159.9970Ref: IN-DA003AAV
5g25.00€10g28.00€25g36.00€50g53.00€5kgTo inquire100g61.00€10kgTo inquire250g111.00€25kgTo inquire500g163.00€Mono-2-o-(p-toluenesulfonyl)-α-cyclodextrin
CAS:Formula:C43H66O32SPurity:98%Molecular weight:1127.0299Mono-2-O-(p-toluenesulfonyl)-γ-cyclodextrin
CAS:Formula:C55H86O42SPurity:>95.0%(HPLC)Molecular weight:1451.3111Mono-6-O-(p-toluenesulfonyl)-α-cyclodextrin
CAS:Formula:C43H66O32SPurity:85.0%Color and Shape:SolidMolecular weight:1127.0299Sugammadex Sodium
CAS:Formula:C72H104Na8O48S8Purity:>95.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:2,177.97Triacetyl-β-cyclodextrin
CAS:Formula:C84H112O56Purity:>97.0%(HPLC)Color and Shape:White powder to crystalMolecular weight:2,017.762-Hydroxypropyl-β-cyclodextrin
CAS:Controlled Product<p>Applications 2-Hydroxypropyl-β-cyclodextrin (HBC) is a widely used modified cyclodextrin, the lipophilic cavity formed by 7 glucose units. Drug solubility in water is greatly enhanced by complexing with 2-Hydroxypropyl-β-cyclodextrin. The number of 2-hydroxypropyl ranges from 5 to 14.<br>References Pitha, J. et al.: Int. J. Pharmacol., 29, 73 (1986); Frijink, H.W. et al.: Pharm. Res., 8, 380 (1991);<br></p>Formula:(C6H10O5)n(C3H6O)Color and Shape:NeatMono(6-mercapto-6-deoxy)-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H70O34SPurity:Min. 95%Color and Shape:PowderMolecular weight:1,151.05 g/mol6-Mono-tert-butyldimethylsilyl-γ-cyclodextrin,
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C54H94O40SIPurity:Min. 95%Molecular weight:1,542.27 g/mol6-Deoxy-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H80O32Purity:Min. 95%Molecular weight:1,169.13 g/molzeta-Cyclodextrin
CAS:<p>Zeta-cyclodextrin (ζ-CD) consists of 11 glucose units. Its larger cavity size offers potential for encapsulating larger guest molecules or forming more complex inclusion compounds.</p>Formula:C66H110O55Purity:Min. 95%Molecular weight:1,783.55 g/molκ-Cyclodextrin
CAS:<p>Kappa-cyclodextrin (κ-CD) contains 15 glucose units. This cyclodextrin has potential applications in host-guest chemistry, particularly for large molecules or assemblies.</p>Purity:Min. 95%Tri-O-benzoyl-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C189H154O56Purity:(%) Min. 95%Color and Shape:PowderMolecular weight:3,321.20 g/molMonoacetyl-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Purity:(%) Min. 95%Color and Shape:Powder6-Monomesyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C49H82SO42Purity:Min. 95%Molecular weight:1,375.22 g/mol3,6-Di-O-acetyl-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C60H84O42Purity:Min. 95%Molecular weight:1,477.28 g/molb-Cyclodextrin hydrogen sulfate, sodium salt
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Purity:Min. 95%Color and Shape:PowderAcetyl-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42Hn)O35·(C2H3O)nPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:1,387.21 g/molMethyl-β-cyclodextrin - 7 to 14 degree of substitution
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C56H98O35Color and Shape:PowderMolecular weight:1,331.36 g/molFluorescein-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H71nNO34•(C21N12NO5S)nPurity:Min. 95%Color and Shape:Powder2-Hydroxypropyl-b-cyclodextrin - Rhodamine labelled
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42•(H)70n•O35•(C3H7)nPurity:Min. 95%2,3-Di-O-acetyl-6-deoxy-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C80H112O48Purity:Min. 95%Molecular weight:1,841.72 g/mol2,3-Di-O-acetyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C80H112O56Purity:Min. 95%Molecular weight:1,969.71 g/mol6-Cyano-6-deoxy-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C49H63N7O28Purity:Min. 95%Molecular weight:1,198.05 g/mol2,3-dimethyl-6-deoxy-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C64H112O32Purity:Min. 95%Molecular weight:1,393.55 g/mol2,3-Dimethyl-6-tert-butyldimethylsilyl-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C84H168O30Si6Purity:Min. 95%Molecular weight:1,826.73 g/molMono(6-(1,6-hexamethylenediamine)-6-deoxy)-β-cyclodextrin
CAS:<p>Mono(6-(1,6-hexamethylenediamine)-6-deoxy)-beta-cyclodextrin is a complex compound that is used as a research chemical, speciality chemical and versatile building block in the synthesis of other chemicals. Mono(6-(1,6-hexamethylenediamine)-6-deoxy)-beta-cyclodextrin can be used as an intermediate in the synthesis of complex compounds. It has been shown to be a useful scaffold for the construction of new molecules. Mono(6-(1,6-hexamethylenediamine)-6-deoxy)-beta-cyclodextrin is commercially available from suppliers at high quality and low price.</p>Formula:C48H84N2O34Purity:Min. 95%Color and Shape:PowderMolecular weight:1,233.17 g/molSBE-β-CD
CAS:<p>β-cyclodextrin sulfobutyl ether (SBE-beta-CD) is an excipient compound incorporating a chemically modified cyclodextrin with a structure that optimizes the solubility and stability of active pharmaceuticals and their properties. It is a highly water-soluble anionic cyclodextrin derivative. SBE-beta-CD can easily form non-covalent inclusion complexes with drug molecules and therefore reduce drug toxicity and haemolysis as well as control drug release rate. The complexing properties of beta- dex sulfobutyl ether also make it suitable for masking unpleasant odors and tastes of pharmaceutical products. It is used as an excipient in injection, oral, nasal, and eye medication.</p>Formula:C70H119Na7O56S7Purity:Min. 98%Color and Shape:White PowderMolecular weight:2,242.05 g/mol2,6-di-O-methyl-3-O-n-pentyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C104H192O40Purity:Min. 95%Molecular weight:2,082.61 g/mol2,3-Di-O-benzyl-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C140H154O35Purity:Min. 95%Molecular weight:2,396.7 g/mol2,6-di-n-pentyl-γ-cyclodextrin
<p>2,6-di-n-pentyl-gamma-cyclodextrin is a glycosylation reagent that is used in the synthesis of oligosaccharides and polysaccharides. It has been used to synthesize an anti-inflammatory agent for the treatment of inflammatory bowel disease. This compound can be modified by Click chemistry, which allows for the attachment of different molecules to its surface. 2,6-di-n-pentyl-gamma-cyclodextrin is also a fluorinated compound with CAS number 689069-46-2.</p>Formula:C128H240O40Purity:Min. 95%Molecular weight:2,419.25 g/mol6-O-Sulfo-β-cyclodextrin sodium
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H63Na7O56S7Purity:(%) Min. 95%Color and Shape:PowderMolecular weight:1,849.31 g/molSuccinyl-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C71H100O55Purity:Min. 95%Color and Shape:White PowderMolecular weight:1,833.52 g/mol6-aminomethyl-6-deoxy-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C55H104N8O32Purity:Min. 95%Molecular weight:1,389.45 g/mol2,3,6-Trioctyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C240H464O40Purity:Min. 95%Molecular weight:3,990.23 g/mol2-Hydroxypropyl-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42Hn)O35·(C3H7O)nPurity:Min. 98.0 Area-%Color and Shape:PowderSuccinyl-(2-hydroxypropyl)-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H70xyO35•(C4H5O3)x•(C3H7O)yPurity:Min. 95%Color and Shape:PowderMolecular weight:1767.592,6-Dimethyl-b-cyclodextrin - Technical
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C56H98O35Purity:Min. 98%Color and Shape:White PowderMolecular weight:1,331.36 g/mol6-Aminomethyl-6-deoxy-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C49H91N7O28Purity:Min. 95%Color and Shape:PowderMolecular weight:1,226.28 g/mol6-Deoxy-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H70O28Purity:Min. 95%Molecular weight:1,022.99 g/molCarboxymethyl-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C56H84O49Purity:Min. 95%Molecular weight:1,541.24 g/mol3,6-Di-O-acetyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C80H112O56Purity:Min. 95%Molecular weight:1,969.71 g/molMethyl-b-cyclodextrin - 3 to 9 degree of substitution
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C56H98O35Color and Shape:White PowderMolecular weight:1331.362,3-Dimethyl-6-amino-6-deoxy-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C64H120N8O32Purity:Min. 95%Molecular weight:1,513.67 g/mol6-O-a-Maltosyl-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C54H90O45Purity:Min. 95%Color and Shape:White PowderMolecular weight:1,459.27 g/mol2,3-Di-O-benzoyl-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C120H108O42Purity:Min. 95%Molecular weight:2,222.12 g/mol2,3-di-O-methyl-6-O-tert-butyldimethylsilyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C112H224O40SI8Purity:Min. 95%Molecular weight:3,258.25 g/molHeptakis-(6-azido-6-deoxy)-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is an azido-functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H63N21O28Purity:Min. 95%Color and Shape:White PowderMolecular weight:1,310.07 g/molγ-Cyclodextrin
CAS:<p>Gamma-cyclodextrin (and its hydrated form) is a cyclic oligosaccharide with 8 D-glucose residues which are α-1,4-linked. Gamma-cyclodextrin is used in the food industry to encapsulate flavors and fragrances. Gamma-cyclodextrin can improve the bioavailability of compounds with low water solubility, such as Coenzyme Q10, which has been used in nutraceuticals. Its cavity size, larger than α- and β-cyclodextrins, allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H80O40Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:1,297.12 g/molMono-6-O-(p-toluenesulfonyl)-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C43H66O32SPurity:Min. 95%Color and Shape:White PowderMolecular weight:1,127.03 g/molβ-Cyclodextrin
CAS:<p>Beta-cyclodextrin (β-CD) is a cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules such as curcumin. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H70O35Purity:Min. 98 Area-%Color and Shape:White Clear LiquidMolecular weight:1,134.98 g/molb-Cyclodextrin sulfobutyl ether sodium salt
CAS:<p>Beta-cyclodextrin sulfobutyl ether is an excipient compound incorporating a chemically modified cyclodextrin with a structure that optimizes the solubility and stability of active pharmaceuticals and their properties. It is a highly water-soluble anionic cyclodextrin derivative. It can easily form non-covalent inclusion complexes with drug molecules and therefore reduce drug toxicity and haemolysis as well as control drug release rate. Its complexing properties also make it suitable for masking unpleasant odors and tastes of pharmaceutical products. It is used as an excipient in injection, oral, nasal, and eye medication.</p>Formula:C70H119Na7O56S7Purity:95 To 105%Color and Shape:White PowderMolecular weight:2,242.05 g/mol2,3-Di-O-allyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C96H144O40Purity:Min. 95%Molecular weight:1,938.15 g/mol6-Mono-tert-butyldimethylsilyl-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C42H74O30SiPurity:Min. 95%Molecular weight:1,087.1 g/moliota-Cyclodextrin
CAS:<p>Iota-cyclodextrin (ι-CD) contains 14 glucose units. This cyclodextrin has potential applications in host-guest chemistry, particularly for large molecules or assemblies.</p>Formula:C84H140O70Purity:Min. 95%Molecular weight:2,269.97 g/mol2,6-di-O-n-pentyl-3-O-acetyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C144H256O48Purity:Min. 95%Molecular weight:2,755.54 g/mol2,3-Di-O-benzyl-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C120H132O30Purity:Min. 95%Molecular weight:2,054.31 g/molMono-2-O-(p-toluenesulfonyl)-γ-cyclodextrin
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Purity:Min. 95 Area-%Color and Shape:Powder2,3-Dimethyl-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C48H84O30Purity:Min. 95%Molecular weight:1,141.16 g/mol6-Amino-6-deoxy-b-cyclodextrin hydrochloride
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H77N7O28·7HClPurity:Min. 95%Color and Shape:White Slightly Yellow PowderMolecular weight:1,383.32 g/mol6-Cyano-6-deoxy-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C56H72N8O32Purity:Min. 95%Molecular weight:1,369.21 g/molMonoacetyl-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C48H72O36Purity:Min. 95%Molecular weight:1,225.06 g/mol6-Deoxy-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C36H60O24Purity:Min. 95%Molecular weight:876.85 g/mol6-Azido-6-deoxy-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H69N3O34Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:1,160 g/mol(2-Hydroxypropyl)-γ-cyclodextrin
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Purity:98 To 102%Color and Shape:Powder2,3,6-Tri-O-benzoyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C216H176O64Purity:Min. 95%Molecular weight:3,795.67 g/mola-Cyclodextrin octadecaacetate
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C72H96O48Purity:Min. 95%Molecular weight:1,729.5 g/mol2,3-Di-O-acetyl-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C60H84O42Purity:Min. 95%Molecular weight:1,477.28 g/mol2,6-Dimethyl-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C56H98O35Purity:Min. 98%Color and Shape:White PowderMolecular weight:1,331.36 g/mol6-O-tert-butyldimethylsilyl-γ-cyclodextrin
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C96H192O40Si8Purity:Min. 95%Molecular weight:2,211.21 g/mol6-Amino-6-deoxy-a-cyclodextrin hydrochloride
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C36H66N6O24·6HClPurity:(%) Min. 95%Color and Shape:PowderMolecular weight:1,185.7 g/mol2,6-di-O-n-pentyl-3-O-trifluroacetyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C144H232F24O48Purity:Min. 95%Molecular weight:3,187.32 g/mol2,6-Di-O-tert-butyldimethylsilyl)-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C126H266O35Si14Purity:Min. 95%Molecular weight:2,734.64 g/molPrednisolone succinate a-cyclodextrin conjugate
<p>The prednisolone succinate cyclodextrin alpha conjugate represents a specific class of cyclodextrin derivatives where the drug molecule (prednisolone succinate) is covalently bound to α-cyclodextrin. The conjugate is designed to combine the beneficial properties of cyclodextrins with the therapeutic effects of prednisolone. Prednisolone succinate cyclodextrin alpha conjugate aims to improve the solubility, stability, and bioavailability of prednisolone while potentially offering controlled release properties.</p>Purity:Min. 95%3,6-Di-tert-butylmethylsilyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C144H304O40SI16Purity:Min. 95%Molecular weight:4,738.47 g/mol2,6-di-O-n-pentyl-3-O-n-butyryl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C160H288O48Purity:Min. 95%Molecular weight:2,979.97 g/molPrednisolone succinate γ-cyclodextrin conjugate
<p>The prednisolone succinate cyclodextrin gamma conjugate represents a specific class of cyclodextrin derivatives where the drug molecule (prednisolone succinate) is covalently bound to γ-cyclodextrin. The conjugate is designed to combine the beneficial properties of cyclodextrins with the therapeutic effects of prednisolone. Prednisolone succinate cyclodextrin gamma conjugate aims to improve the solubility, stability, and bioavailability of prednisolone while potentially offering controlled release properties.</p>Purity:Min. 95%Mono-(2,3-di-O-benzyl)-(2,3,6-tri-O-benzyl)-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C209H218O40Purity:Min. 95%Molecular weight:3,369.94 g/molPrednisolone succinate b-cyclodextrin conjugate
<p>The prednisolone succinate cyclodextrin beta conjugate represents a specific class of cyclodextrin derivatives where the drug molecule (prednisolone succinate) is covalently bound to β-cyclodextrin. The conjugate is designed to combine the beneficial properties of cyclodextrins with the therapeutic effects of prednisolone. Prednisolone succinate cyclodextrin beta conjugate aims to improve the solubility, stability, and bioavailability of prednisolone while potentially offering controlled release properties.</p>Purity:Min. 95%2,6-Di-tert-butyldimethylsilyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C144H304O40Si16Purity:Min. 95%Molecular weight:3,125.3 g/mol2,3-Di-O-acetyl-6-O-tert-butyldimethylsilyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C12H224O56SI8Purity:Min. 95%Molecular weight:2,313.18 g/mol2,3-Dimethyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C64H112O40Purity:Min. 95%Molecular weight:1,521.55 g/mol2,3,6-Tri-O-benzyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C216H224O40Purity:Min. 95%Molecular weight:3,460.07 g/moleta-Cyclodextrins
<p>Eta-cyclodextrin (η-CD) contains 12 glucose units. This cyclodextrin has potential applications in host-guest chemistry, particularly for large molecules or assemblies.</p>Purity:Min. 95%(2-Hydroxyethyl)-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Color and Shape:Powdera-Cyclodextrin
CAS:<p>α-Cyclodextrin is a cyclic oligosaccharide with 6 D-glucose residues which are α-1,4-linked. α-cyclodextrin is used in the food industry to encapsulate flavours and fragrances. α-cyclodextrin is also an effective inhibitor of the upstream inflammatory response induced by cholesterol crystals. Cholesterol crystal-induced complement activation is a critical step in the development of atherosclerosis, thus inhibition of complement with α-cyclodextrin has the potential to be used in the treatment of atherosclerosis.</p>Formula:C36H60O30Purity:Min. 98 Area-%Color and Shape:White Off-White PowderMolecular weight:972.84 g/mol(2-Carboxyethyl)-b-cyclodextrin sodium
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H70nO35•(C3H4O2Na)nPurity:Min. 95%Color and Shape:White to pale yellowsolid.Molecular weight:1,135 g/mol6-Chloro-6-deoxy-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H63Cl7O28Purity:Min. 95%Molecular weight:1,264.1 g/molSuccinyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative (Suc-γ-CD) is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H80nO40•(C4H5O3)nPurity:Min. 95%Color and Shape:PowderMolecular weight:1,297.2 g/mol3,6-Dimethyl-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C48H84O30Purity:Min. 95%Molecular weight:1,141.16 g/molCarboxymethyl-γ-cyclodextrin sodium salt
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C54H86O46·xNaPurity:Min. 95%Color and Shape:PowderMolecular weight:1,471.23 g/molθ-Cyclodextrins
<p>Theta-cyclodextrin (θ-CD) contains 13 glucose units. This cyclodextrin has potential applications in host-guest chemistry, particularly for large molecules or assemblies.</p>Purity:Min. 95%6-Bromo-6-deoxy-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C36H54Br6O24Purity:Min. 95%Molecular weight:1,350.22 g/mol2,6-Dimethyl-a-cyclodextrin >70%
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C48H84O30Purity:Min. 95%Color and Shape:PowderMolecular weight:1,141.16 g/mol6-Chloro-6-deoxy-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C36H54Cl6O24Purity:Min. 95%Molecular weight:1,083.52 g/molε-Cyclodextrin
CAS:<p>Epsilon-cyclodextrin (ε-CD) consists of 10 glucose units. Its larger cavity size offers potential for encapsulating larger guest molecules or forming more complex inclusion compounds.</p>Formula:C60H100O50Purity:Min. 95%Molecular weight:1,621.41 g/mol2,3-Di-O-allyl-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C72H108O30Purity:Min. 95%Molecular weight:1,453.61 g/mol6-Deoxy-6-thio-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H70O28S7Purity:Min. 95%Color and Shape:PowderMolecular weight:1,247.45 g/molMono-6-O-(p-toluenesulfonyl)-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C49H76O37SPurity:Min. 85 Area-%Color and Shape:PowderMolecular weight:1,289.17 g/molCarboxymethyl-b-cyclodextrin sodium salt
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C49H74O42·xNaPurity:Min. 95%Color and Shape:White PowderMolecular weight:1,335.09 g/mol6-Deoxy-6-iodo-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H63I7O28Purity:Min. 95%Color and Shape:White PowderMolecular weight:1,904.26 g/mol6-Deoxy-6-thio-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C36H60O24S6Purity:Min. 95%Molecular weight:1,069.24 g/molCarboxymethyl-a-cyclodextrin sodium salt
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C43H64O37·xNaPurity:Min. 95%Molecular weight:1,172.95 g/molA,D-6-di-acetyl-β-Cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C46H74O37Purity:Min. 95%Color and Shape:PowderMolecular weight:1,219.06 g/molγ-Cyclodextrin dihydrogen phosphate sodium salt
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H80O40Purity:Min. 95%Molecular weight:1,297.12 g/molMono-6-O-mesitylenesulfonyl-γ-cyclodextrin
CAS:Formula:C57H90O42SPurity:>90.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,479.37Heptakis(2,3-di-O-acetyl-6-O-tert-butyldimethylsilyl)cyclomaltoheptaose
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C112H196O49Si7Purity:Min. 95%Molecular weight:2,523.32 g/mol6-tert-Butyldimethylsilyl-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C72H144O30Si6Purity:Min. 95%Molecular weight:1,658.41 g/mol6-Amino-6-deoxy-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H71NO34Molecular weight:1,134 g/molHeptakis(2,3-di-O-methyl-6-O-sulfo)-β-cyclodextrin heptasodium
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C56H98O56S7Purity:Min. 95%Molecular weight:1890.286576-Tert-butyldimethylsilyl-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C84H168O35Si7Purity:Min. 95%Molecular weight:1,934.81 g/mol2,3,6-Triethyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C95H176O40Purity:Min. 95%Molecular weight:1,958.39 g/mol2,3-Dimethyl-6-tert-butyldimethylsilyl-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C98H196O35Si7Purity:Min. 95 Area-%Color and Shape:White Off-White PowderMolecular weight:2,131.18 g/molMaltotetraosyl-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Purity:Min. 95%a-Cyclodextrin dihydrogen phosphate sodium salt
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C36H60O30Purity:Min. 95%Molecular weight:972.84 g/mol6-Chloro-6-deoxy-γ-cyclodextrin
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H72Cl8O32Purity:Min. 95%Molecular weight:1,444.69 g/mol2,6-Di-O-methyl-β-cyclodextrin
CAS:Formula:C56H98O35Purity:>95.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:1,331.37Heptakis(2,3,6-tri-O-ethyl)cyclomaltoheptaose
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C84H154O35Purity:Min. 95%Molecular weight:1,724.1 g/molHexakis-(6-azido-6-deoxy)-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C36H54N18O24Purity:Min. 95%Color and Shape:PowderMolecular weight:1,122.92 g/mol(2-Carboxyethyl)-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C45H72O39Purity:Min. 95%Molecular weight:1,237.03 g/mol2,3-Di-O-acetyl-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C70H98O49Purity:Min. 95%Molecular weight:1,723.5 g/molTri-O-acetyl-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C84H112O56Purity:Min. 95%Color and Shape:PowderMolecular weight:2,017.75 g/molSuccinyl-(2-hydroxypropyl)-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Purity:Min. 95%6-Aminomethyl-6-deoxy-a-cyclodextrin
<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C42H78N6O24Purity:Min. 95%Molecular weight:1,051.09 g/mol2,3-Dimethyl-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C56H98O35Purity:Min. 95%Color and Shape:PowderMolecular weight:1,331.36 g/mol2,3-Di-O-allyl-b-cyclodextrin
<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C84H126O35Purity:Min. 95%Molecular weight:1,695.88 g/molSugammadex
CAS:<p>Sugammadex is a modified gamma-cyclodextrin specifically designed to reverse the effects of steroidal non-depolarizing neuromuscular blocking drugs, particularly rocuronium and vecuronium. In anesthesiology, it offers a novel approach to neuromuscular blockade reversal by directly encapsulating and inactivating these muscle relaxants. Sugammadex forms tight 1:1 complexes with free plasma rocuronium or vecuronium molecules, rapidly reducing their concentration at the neuromuscular junction. This mechanism allows for fast and predictable reversal of neuromuscular blockade, even from deep levels, without the need for anticholinesterases or antimuscarinic agents. Sugammadex has also shown promise in special populations, including pregnancy, pediatrics, and patients with renal or hepatic impairment.</p>Formula:C72H112O48S8Purity:Min. 95%Molecular weight:2,002.16 g/mol6-O-a-D-Glucosyl-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C42H70O35Purity:Min. 95%Molecular weight:1,134.98 g/molSuccinyl-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C40H64O33Purity:Min. 95%Molecular weight:1,072.92 g/molHeptakis-(2,3,6-tri-O-methyl)-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C63H112O35Purity:Min. 95%Color and Shape:PowderMolecular weight:1,429.54 g/mol(2-Hydroxypropyl)-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.2-hydroxypropyl-alpha-cyclodextrin (HPCD) forms a stable inclusion complex with iodine. It also serves as a co-polymer for gene delivery vectors.</p>Color and Shape:PowderMolecular weight:1.0Mono(6-ethanediamine-6-deoxy)-β-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C44H76N2O34Purity:Min. 95%Molecular weight:1,177.1 g/mol6-deoxy-6-iodo-γ-cyclodextrin
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H72I8O32Purity:Min. 95%Color and Shape:PowderMolecular weight:2,176.3 g/molMono-2-O-(p-toluenesulfonyl)-b-cyclodextrin hydrate
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C49H76O37S•(H2O)xPurity:Min. 97 Area-%Color and Shape:PowderMolecular weight:1,289.17 g/molTriethyl-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C72H132O30Purity:Min. 95%Molecular weight:1,477.8 g/mola-Cyclodextrin sulfate sodium salt
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Purity:Min. 95%Color and Shape:White Powder6-bromo-6-deoxy-γ-cyclodextrin
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H72Br8O32Purity:Min. 95%Molecular weight:1,800.3 g/mol6-Bromo-6-deoxy-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H63Br7O28Purity:Min. 95%Color and Shape:White PowderMolecular weight:1,575.26 g/mol2,3,6-Trimethyl-γ-cyclodextrin
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C72H128O40Purity:Min. 95%Color and Shape:PowderMolecular weight:1,633.8 g/molb-Cyclodextrin dihydrogen phosphate, sodium salt
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C42H70O35Purity:Min. 95%Molecular weight:1,134.98 g/mol6-Amino-6-deoxy-γ-cyclodextrin hydrochloride
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H88N8O32·8HClPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:1,580.93 g/molβ-Cyclodextrin polymer crosslinked with epichlorohydrin
<p>β-Cyclodextrin polymer crosslinked with epichlorohydrin (β-CD-EP) is a high molecular weight, water-insoluble compound that combines the advantageous properties of cyclodextrins and polymers. It is synthesized by crosslinking β-cyclodextrin molecules with epichlorohydrin (either the R- or S-isomer, although is normally a racemic mixture) under strongly alkaline conditions. This material retains the host-guest complex formation ability of cyclodextrins while offering enhanced stability and physicochemical properties. In pharmaceuticals, β-CD-EP serves as an effective drug carrier, improving the solubility and bioavailability of poorly water-soluble drugs, masking unpleasant tastes, and enabling controlled release of active ingredients. Its insoluble nature makes it particularly useful in environmental applications for removing organic pollutants and heavy metals from water. In analytical chemistry, β-CD-EP is employed for the extraction and concentration of target substances, such as mycotoxins from beverages. The polymer's unique structure, featuring a dense, hydrophobic cross-linked core and a more hydrophilic surface, contributes to its dual adsorption mechanism through the inclusion of complex formation and physical adsorption. Recent advancements have led to β-CD-EP variants with ionic functional groups, expanding its potential in water treatment and pharmaceutical formulations.</p>Color and Shape:Powder6-Monodeoxy-6-monoamino-γ-cyclodextrin,
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H81NO39Purity:Min. 95%Molecular weight:1,296.14 g/molγ-Cyclodextrin hydrate
CAS:<p>Gamma-cyclodextrin (γ-CD) is a cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H80O40•(H2O)xPurity:Min. 95%Color and Shape:PowderMolecular weight:1,297.12 g/mol6-Cyano-6-deoxy-a-cyclodextrin
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C42H54N6O24Purity:Min. 95%Molecular weight:1,026.9 g/molMono-(6-(diethylenetriamine)-6-deoxy)-β-Cyclodextrin
CAS:<p>Please enquire for more information about Mono-(6-(diethylenetriamine)-6-deoxy)-β-Cyclodextrin including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C46H81N3O34Purity:Min. 95%Molecular weight:1,220.1 g/mol2,3-Di-O-benzyl-6-O-tert-butyldimethylsilyl-γ-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C208H288O40SI8Purity:Min. 95%Molecular weight:4,475.79 g/molButyl-y-cyclodextrin
<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Purity:Min. 95%Mono-2-O-(p-toluenesulfonyl)-γ-cyclodextrin
CAS:Formula:C55H86O42SPurity:>95.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,451.31Mono-2-O-(p-toluenesulfonyl)-α-cyclodextrin
CAS:Formula:C43H66O32SPurity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,127.03




